Answered: Acetic acid (HC2H3O2) is a weak acid…

Acetic acid (HC2H3O2) is a weak acid with a single 3)A) proton. a) Calculate the pH of the 0.100 М НС2НЗ02 solution. (For HC2H3O2) Ka: 1,76x10)

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter15: Solutions Of Acids And Bases

Section: Chapter Questions

Problem 15.68QE

See similar textbooks

Related questions

Q: The weak acid HZ has a Ka of 2.55×10−4. Calculate the pH of 0.040 M HZ.

Q: A 0.17 M solution of a weak acid has a pH of 2.85. What is the ka of the weak acid?

A: Given: concentration of weak acid=0.17M pH of weak acid=2.85 To calculate: Ka of weak…

Q: A 0.035 M solution of a weak acid (HA) has a pH of 4.88.What is the Kₐ of the acid?

Q: A 0.0722 M solution of a weak acid has a pH of 3.11. Calculate the Ka of this acid.

A: A weak acid is an acid that dissociates partially to give H3O+ in water. The dissociation of a weak…

Q: Phenylacetic acid (C6H5CH2COOH, simplified here to HPAc; see model) builds up in the blood of…

A: Solution- Given data: The pH of Phenylacetic acid = 2.62. The concentration of C6H5CH2COOH…

Q: Calculate pH of the following solutions: a) 0.25 M HNO3 in 0.065 M CH3COOH (K,=1.75x10). b) 0.33 M…

Q: Calculate the pH of each solution.(a) [H3O+] = 1.7 * 10-8 M(b) [H3O+] = 1.0 * 10-7 M(c) [H3O+] = 2.2…

Q: the Ph of a 0.050 M weak acid solution is 5.25. Calculate the Ka of the acid.

A: Given, pH of weak acid= 5.25 [weak acid ] =0.050 M Ka = ?

Q: Consider the following ions: Cl-, HS-, NO2-, F-, and HS04-. (a) Which of these ions in water gives…

A: Given ions Cl- HS- NO2- F- HSO4-

Q: The pH of a 0.063-M solution of hypobromous acid (HOBr but usually written HBrO) is 4.95. calculate…

A: Given: pH of hypobromous acid, HOBr = 4.95 Concentration of HOBr acid = 0.063 M Ka = ?

Q: A 0.037 M solution of a weak acid (HA) has a pH of 4.34. What is the Ka of the acid?

Q: Determine the Ka of an acid whose 0.294 M solution has a pH of 2.80.

Q: 0.05 Μ of a weak acid solution (HA) ionizes 0.2 percent in water. Find its acid dissociation…

A: Concentration of weak acid, c = 0.05 M Percentage ionisation = 0.2% x = 0.002

Q: If a 0.8M solution of weak acid, HA, has a pH = 2.8, calculate the Ka of the acid. Your answer…

A: HA ⇌ H+ + A- At initial c 0 0at final c1-α…

Q: Calculate the pH of each of the following solutions of a strong acid in water. (a) 0.22 М HCI (b)…

Q: The pH of saliva is normally in the range of 6.4 to 7.0. However, when a person is ill, the person's…

A: pH is defined as negative logarithm of hydrogen ion concentration pH= -log[H+] If pH<7 then the…

Q: Please explain. What is the pH of a 0.13 molar solution of NH4Cl. where Kb for NH3 = 1.8 10–5)

Q: Calcula te the value of H20* from the given OH in each solution and label the so lution as acidic or…

A: Given: a) [OH- ] = 10-3 M b) [OH- ] = 10-10 M

Q: Calculate the [H+] fo (a) black coffee with a pH of 4.57 (Enter your answer as follows: 1.0E-2…

A: a. Calculation for [H+] of black coffee: pH=-log[H+][H+]=10-pH[H+]=10-4.57[H+]=2.7×10-5=2.7E-5

Q: Consider a solution which is 0.10M in CH3COOH and 0.20M in NaCH3COO. Choose ALL of the following…

A: The pH scale is logarithmic, indicating the hydrogen ion concentration in the solution. The method…

Q: A solution is 0.25 M HNO2 and 0.24 M NaNO2. What is the pH of the solution. (Ka(HNO2) = 4.5x10-4…

A: Here is a solution of weak acid and its conjugate base salt. So it is a buffer solution. pH of…

Q: Calculate pH of the following solutions: 0.25 M HNO3 in 0.065 M CH COOH (K.=1.75x10).

A: Solution: We know the common ion aslo affect on oH of the solution. Here first we need to draw an…

Q: 0.021 M solution of a weak acid (HA) has a pH of 4.19. What is the Ka of the acid?

A: Ka is acid dissociation constants of weak acid. Weak acid dissociated feabily in aqueous solution

Q: Sulfurous acid (H2SO3) is a diprotic acid with ?a1=1.39×10^(−2) and ?a2=6.73×10^(−8). Determine the…

Q: A student needs a sample of 0.772539887245 M NaOH for a laboratory experiment. Calculate (a) the…

A: It is given that the concentration of sodium hydroxide (NaOH) sample is 0.772539887245 M, the…

Q: What is the pH of a solution that is 0.041 M in NH4Cl?

A: NH4Cl salt can be formed from weak base NH4OH and strong acid HCl. So it is a salt of strong acid…

Q: 5. The pH of a 0.035 M solution of a weak acid, HX, is 4.25. (a) Calculate Ka for HX and (b)…

A: The pH of a 0.035 M solution of a weak acid, HX, is 4.25. a) Ka for HX and b) the percent ionization…

Q: Suppose 5.00 g of propanoic acid (HC3H5O2) is dissolved in enough water to yield 100.0 mL of…

A: Molar mass of propanoic acid = 3×12+6×1+2×16=74g/mol Number of moles = massmolar…

Q: The pH of a nitric acid (HNO:) solution is 3.85 Determine the [H*] in the HNO3 solution. Calculate…

Q: Citric acid, which is present in citrus fruits, is a triprotic acid (Ka1=7.4x10^-4; Ka2=1.7x10^-5;…

Q: Acetic acid, (HC2H3O2) is a weak acid (Ka = 1.8 10–5). Calculate the pH of a 14.4 M H

A: pH is used for the measurement of potential of hydrogen ions.

Q: A 0.2 M solution of a weak acid HA dissociates such that 99.5% of the weak acid remains intact…

Q: How can you increase the pH of a solution when The pH of its equal 7 ? O (a) By adding a small…

A: The negative logarithm of hydrogen ion concentration is defined as the pH of the solution. It is…

Concept explainers

Ionic Equilibrium

Chemical equilibrium and ionic equilibrium are two major concepts in chemistry. Ionic equilibrium deals with the equilibrium involved in an ionization process while chemical equilibrium deals with the equilibrium during a chemical change. Ionic equilibrium is established between the ions and unionized species in a system. Understanding the concept of ionic equilibrium is very important to answer the questions related to certain chemical reactions in chemistry.

Arrhenius Acid

Arrhenius acid act as a good electrolyte as it dissociates to its respective ions in the aqueous solutions. Keeping it similar to the general acid properties, Arrhenius acid also neutralizes bases and turns litmus paper into red.

Bronsted Lowry Base In Inorganic Chemistry

Bronsted-Lowry base in inorganic chemistry is any chemical substance that can accept a proton from the other chemical substance it is reacting with.

Question

Acetic acid (HC2H3O2) is a
weak acid with a single
3)A)
proton.
a) Calculate the pH of the
0.100 М НС2НЗ02
solution. (For HC2H3O2)
| Ka: 1,76x10)

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Step by step

Solved in 3 steps with 3 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

A student prepares 455 mL of a KOH solution, but neglects to write down the mass of KOH added. His TA suggests that he take the pH of the solution. The pH is 13.33. How many grams of KOH were added?
Why have chemists not tabulated the fraction ionized for different acids? Such a table would make problems such as calculating the pH of an acid solution quite simple.
How many significant figures are there in the following numbers: 10.78, 6.78, 0.78? If these were pH values, to how many significant figures can you express the [H+]? Explain any discrepancies between your answers to the two questions.
1. Which of the following can act as a Lewis acid? (Hint : In each case, draw the Lewis electron dot structure of the molecule or ion. Are there lone pairs of electrons on the central atom? If so, it can be a Lewis base. Does the central atom lack an electron pair? If so, it can behave as a Lewis acid.) PH3 BCl3 H2S HS−
You are asked to calculate the H+ concentration in a solution of NaOH(aq). Because sodium hydroxide is a base, can we say there is no H+. since having H+ would imply that the solution is acidic?
Consider two weak acids, HA (MM=138g/mol)and HB (MM=72.0g/mol). A solution consisting of 11.0 g of HA in 745 mL has the same pH as a solution made up of 5.00 g of HB in 525 mL. Which of the two acids is stronger? Justify your answer by an appropriate calculation.
Novocaine, C13H21O2N2Cl, is the salt of the base procaine and hydrochloric acid. The ionization constant for procaine is 7106. 15 a solution of novocaine acidic or basic? What are [H3O+], [OH-], and pH of a 2.0% solution by mass of novocaine, assuming that the density of the solution is 1.0 g/mL.
. Using Fig. 16.3, list the approximate pH value of live “everyday” solutions. How do the familiar properties (such as the sour taste for acids) of these solutions correspond to their indicated pH?
A solution is made by dissolving 15.0 g sodium hydroxide in approximately 450 mL water. The solution becomes quite warm, but after it is allowed to return to room temperature, water is added to bring the volume to 500.0 mL of solution. (a) Calculate the pH and pOH in the final solution. (b) Why would we wait for it to return to room temperature? (c) If the mass of the water used to initially dissolve the sodium hydroxide were exactly 450 g and the temperature of the water increased by 8.865 C, how much heat was given off by the dissolution of 15.0 g of solute? Assume the specific heat of the solution is 4.184 J/g. K. What is the molar heat change for the dissolution of sodium hydroxide (known as the enthalpy of solution, Hsol)?
What is the pH of a solution obtained by mixing 235 mL of NaOH with a pH of 11.57 and 316 mL of Sr(OH)2 with a pH of 12.09? Assume that volumes are additive.
A chilled carbonated beverage is opened and warmed to room temperature. Does the pH change and, if so, how does it change?
Which of the following compounds or ions has the weakest conjugate base? Briefly explain your choice. a) HCN b) HClO c) NH4+