A voltaic cell is constructed from a standard Cu2+|Cu half cell (E°red0.337V) and%Da standard H+|H2 half cell (E°red0.000V).%3|The anode reaction is:++The cathode reaction is:+The spontaneous cell reaction is:++|The cell voltage isV.+↑

Answered: Image /qna-images/answer/e1079eb6-4544-4022-af14-94dc651c8dc0.jpg

A voltaic cell is constructed from a standard Cu2+|Cu half cell (E°red 0.337V) and %3D a standard H*|H2 half cell (E°red 0.000V). %3D The anode reaction is: > + The cathode reaction is: + + The spontaneous cell reaction is: + + The cell voltage is V.

A voltaic cell is constructed from a standard Cu2+|Cu half cell (E°red 0.337V) and %3D a standard H*|H2 half cell (E°red 0.000V). %3D The anode reaction is: > + The cathode reaction is: + + The spontaneous cell reaction is: + + The cell voltage is V.

Fundamentals Of Analytical Chemistry

9th Edition

ISBN:9781285640686

Author:Skoog

Publisher:Skoog

Chapter19: Applications Of Standard Electrode Potentials

Section: Chapter Questions

Problem 19.8QAP

See similar textbooks

Similar questions

Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
A standard galvanic cell is constructed so that the overall cell reaction is 2A13++(aq)+3M(s)3M2+(aq)+2A1(s) Where M is an unknown metal. If G = 411 kJ for the overall cell reaction, identify the metal used to construct the standard cell.
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).
An aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?
At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
Identify each statement as true or false. Rewrite each false statement to make it true. (a) Oxidation always occurs at the anode of an electrochemical cell. (b) The anode of a discharging voltaic cell is the site ofreduction and is negative. (c) Standard-state conditions for electrochemical cells are aconcentration of 1.0 M for dissolved species and a pressure of 1 bar for gases. (d) The potential of a voltaic cell does not change withtemperature. (e) All product-favored oxidation-reduction reactions have astandard cell potential Ecell, with a negative sign.
The mass of three different metal electrodes, each from a different galvanic cell, were determined before and after the current generated by the oxidation-reduction reaction in each cell was allowed to flow for a few minutes. The first metal electrode, given the label A, was found to have increased in mass; the second metal electrode, given the label B, did not change in mass; and the third metal electrode, given the label C, was found to have lost mass. Make an educated guess as to which electrodes were active and which were inert electrodes, and which were anode(s) and which were the cathode(s).
Given this reaction, its standard potential, and the standard half-cell potential of 0.34 V for the Cu2+ |Cu half-cell, calculate E° for the Fe(s)|Fe2+(aq) half-cell.
Consider a galvanic cell based on the following half-reactions: a. What is the standard potential for this cell? b. A nonstandard cell is set up at 25C with [Mg2+] = 1.00 105 M. The cell potential is observed to be 4.01 V. Calculate [Au3+] in this cell.