A mixture of 8.05 moles of A, 10.36 moles of B, and 27.16 moles of C is placed in a one-liter container at a certain temperature. The reaction is allowed to reach equilibrium. At equilibrium the number of moles of B is 17.63. Calculate the equilibrium constant for the reaction: A (g) + 2 B (g) - 3 C (g) Hint: Apply RICE method. R-reaction: aA + bB + CC + dD |-initial concentration: 0 0 C-Change: -X -X E-equilibrium concentration: +X -X

A mixture of 8.05 moles of A, 10.36 moles of B, and 27.16 moles of C is placed in a one-liter container at a certain temperature. The reaction is allowed to reach equilibrium. At equilibrium the number of moles of B is 17.63. Calculate the equilibrium constant for the reaction: A (g) + 2 B (g) - 3 C (g) Hint: Apply RICE method. R-reaction: aA + bB + CC + dD |-initial concentration: 0 0 C-Change: -X -X E-equilibrium concentration: +X -X

Introductory Chemistry: A Foundation

9th Edition

ISBN:9781337399425

Author:Steven S. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Donald J. DeCoste

Chapter17: Equilibrium

Section: Chapter Questions

Problem 13CR

See similar textbooks

Similar questions

At a certain temperature, K=0.29 for the decomposition of two moles of iodine trichloride, ICl3(s), to chlorine and iodine gases. The partial pressure of chlorine gas at equilibrium is three times that of iodine gas. What are the partial pressures of iodine and chlorine at equilibrium?
Describe a nonchemical system that is in equilibrium, and explain how the principles of equilibrium apply to the system.
A sample of gaseous nitrosyl bromide (NOBr) was placed in a container tiued with a frictionless, massless piston, where it decomposed at 25C according to the following equation: 2NOBr(g)2NO(g)+Br2(g) The initial density of the system was recorded as 4.495 g/L. After equilibrium was reached, the density was noted to be 4.086 g/L. a. Determine the value of the equilibrium constant K for the reaction. b. If Ar(g) is added to the system at equilibrium at constant temperature, what will happen to the equilibrium position? What happens to the value of K? Explain each answer
Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
Write an equation for an equilibrium system that would lead to the following expressions (ac) for K. (a) K=(Pco)2 (PH2)5(PC2H6)(PH2O)2 (b) K=(PNH3)4 (PO2)5(PNO)4 (PH2O)6 (c) K=[ ClO3 ]2 [ Mn2+ ]2(Pcl2)[ MNO4 ]2 [ H+ ]4 ; liquid water is a product
Draw a nanoscale (particulate) level diagram for an equilibrium mixture of
1’he reaction in Exercise 12.33 was repeated. This time, the reaction began when only NO was injected into the reaction container. 110.200 mol L_l NO was injected, what were the equilibrium concentrations of all species? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) ^2 NO K = 4.1 X 10~4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L"' ofO2, what were the equilibrium concentrations of all species?
Suppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this constant tell you about the relative concentrations of products and reactants that will be present once equilibrium is reached? Is this reaction likely to be a good source of the products?
Show that the complete chemical equation, the total ionic equation, and the net ionic equation for the reaction represented by the equation KI(aq)+I2(aq)KI3(aq) give the same expression for the reaction quotient. KI3 is composed of the ions K+ and I3-.
The diagram represents an equilibrium mixture for the reaction N2(g) + O2(g) ⇌ 2 NO(g) Estimate the equilibrium constant.
For the system SO3(g)SO2(g)+12 O2(g)at 1000 K, K=0.45. Sulfur trioxide, originally at 1.00 atm pressure, partially dissociates to SO2 and O2 at 1000 K. What is its partial pressure at equilibrium?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?