A certain chemical reaction releases 3.45 kJ of heat energy per mole of reactant consumed. Suppose some moles of the reactant are put into a calorimeter (a device for measuring heat flow). It takes 50.9 J of heat energy to raise the temperature of this calorimeter by 1°C. Now the reaction is run until all the reactant is gone, and the temperature of the calorimeter is found to rise by 10.5°C. Calculate the number of moles of reactant that were consumed. (Write a number to the correct number of significant figures. Write JUST the number, WITHOUT UNITS)

Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.

When a 0.740-g sample of trinitrotoluene (TNT), C7H5N2O6, is burned in a bomb calorimeter, the temperature increases from 23.4 C to 26.9 C. The heat capacity of the calorimeter is 534 J/C, and it contains 675 mL of water. How much heat was produced by the combustion of the TNT sample?

9.41 Under what conditions does the enthalpy change equal the heat of a process?

Give the definition of the standard enthalpy of formation for a substance. Write separate reactions for the formation of NaCl, H2O , C6H12O6, and PbSO4 that have H values equal to Hf for each compound.

How much heat is produced when loo mL of 0.250 M HCl (density, 1.00 g/mL) and 200 mL of 0.150 M NaOH (density, 1.00 g/mL) are mixed? HCl(aq)+NaO(aq)NaCl(aq)+H2O(l)H298=58kJ If both solutions are at the same temperature and the heat capacity of the products is 4.19 J/g C, how much will the temperature increase? What assumption did you make in your calculation?

Nitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?

When calcium carbonate, CaCO3 (the major constituent of limestone and seashells), is heated, it decomposes to calcium oxide (quicklime). CaCO3(s)CaO(s)+CO2(g);H=177.9kJ How much heat is required to decompose 21.3 g of calcium carbonate?

A 21.3-mL sample of 0.977 M NaOH is mixed with 29.5 mL of 0.918 M HCl in a coffee-cup calorimeter (see Section 6.6 of your text for a description of a coffee-cup calorimeter). The enthalpy of the reaction, written with the lowest whole-number coefficients, is 55.8 kJ. Both solutions are at 19.6C prior to mixing and reacting. What is the final temperature of the reaction mixture? When solving this problem, assume that no heat is lost from the calorimeter to the surroundings, the density of all solutions is 1.00 g/mL, the specific heat of all solutions is the same as that of water, and volumes are additive.

In a coffee-cup calorimeter, 150.0 mL of 0.50 M HCI is added to 50.0 mL of 1.00 M NaOH to make 200.0 g solution at an initial temperature of 48.2C. If the enthalpy of neutralization for the reaction between a strong acid and a strong base is 56 kJ/mol, calculate the final temperature of the calorimeter contents. Assume the specific heat capacity of the solution is 4.184 J/g C and assume no heat Joss to the surroundings.