8) Consider the galvanic cell constructed with the following materials Zn electro Zn(NO3)2(aq), Fe electrode, Fe(NO3)3(aq) : a) Sketch a diagram of the galvanic cell identifying each material and labeling the cathod and anode b) Determine the overall cell reaction and calculate E°cell- c) Calculate AGO and K for the cell reaction at 25°C. d) Calculate Ecell at 25°C when [Zn2+] 1.0x10-2 M and [Fe2+] 1.0x10-4 M.

8) Consider the galvanic cell constructed with the following materials Zn electro Zn(NO3)2(aq), Fe electrode, Fe(NO3)3(aq) : a) Sketch a diagram of the galvanic cell identifying each material and labeling the cathod and anode b) Determine the overall cell reaction and calculate E°cell- c) Calculate AGO and K for the cell reaction at 25°C. d) Calculate Ecell at 25°C when [Zn2+] 1.0x10-2 M and [Fe2+] 1.0x10-4 M.

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 14P

See similar textbooks

Similar questions

For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
You have 1.0 M solutions of Al(NO3)3 and AgNO3 along with Al and Ag electrodes to construct a voltaic cell. The salt bridge contains a saturated solution of KCl. Complete the picture associated with this problem by a writing the symbols of the elements and ions in the appropriate areas (both solutions and electrodes). b identifying the anode and cathode. c indicating the direction of electron flow through the external circuit. d indicating the cell potential (assume standard conditions, with no current flowing). e writing the appropriate half-reaction under each of the containers. f indicating the direction of ion flow in the salt bridge. g identifying the species undergoing oxidation and reduction. h writing the balanced overall reaction for the cell.
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
A half-cell that consists of a copper wire in a 1.00 M Cu(NO3)2 solution is connected by a salt bridge to a solution that is 1.00 M in both Pu3+ and Pu4+, and contains an inert metal electrode. The voltage of the cell is 0.642 V, with the copper as the negative electrode. (a) Write the half-reactions and the overall equation for the spontaneous chemical reaction. (b) Use the standard potential of the copper half-reaction, with the voltage of the cell, to calculate the standard reduction potential for the plutonium half-reaction.
Calculate the standard cell potential of the following cell at 25C. Sn(s)Sn2+(aq)I2(aq)I(aq)
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
Consider a voltaic cell in which the following reaction takes place in basic medium at 25°C. 2NO3-(aq)+3S2(aq)+4H2O3S(s)+2NO(g)+8OH(aq) (a) Calculate E°. (b) Write the Nernst equation for the cell E. (c) Calculate E under the following conditions: PNO=0.994atm,ph=13.7,[S2]=0.154M,[NO3-]=0.472M, .
A solution contains the ions H+, Ag+, Pb2+, and Ba2+, each at a concentration of 1.0 M. (a) Which of these ions would be reduced first at the cathode during an electrolysis? (b) After the first ion has been completely removed by electrolysis, which is the second ion to be reduced? (c) Which, if any, of these ions cannot be reduced by the electrolysis of the aqueous solution?
For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+
The mass of three different metal electrodes, each from a different galvanic cell, were determined before and after the current generated by the oxidation-reduction reaction in each cell was allowed to flow for a few minutes. The first metal electrode, given the label A, was found to have increased in mass; the second metal electrode, given the label B, did not change in mass; and the third metal electrode, given the label C, was found to have lost mass. Make an educated guess as to which electrodes were active and which were inert electrodes, and which were anode(s) and which were the cathode(s).
It took 150. s for a current of 1.25 A to plate out 0.109 g of a metal from a solution containing its cations. Show that it is not possible for the cations to have a charge of 1+.