6. Predict the products of the following reactions. a. CH31 excess Ag2O, H₂O Heat b. Na№3 Heat H₂O C. N-H Br d. Br Br NaOH KOH H₂O 1 equiv. CH3NH2

Q: a. Which of the following substances would be expected to have the highest boiling point? ○ Mg OH₂ ○…

A: FOR ANY QUERIES, PING ME     HAPPY LEARNING

Q: Organic Chemistry Problem The molecular formula for the problem in the images attached is C8H16O2.…

A: Step 1:identify the structure Step 2: Step 3: Step 4:

Q: 2. Predict the product(s) of the following reactions. NaOH, H₂O HCI H3C CH3COCI, AICI 3 NH2 excess…

A:

Q: 5. Rank the following from lowest to highest boiling point? a. Provide the IUPAC name for the…

A: Part 1) The forces of attraction between molecules in a liquid state are determined by the polarity…

Q: 4. Propose a synthesis and curved arrow mechanism for the following transformation: OH

A:

Q: Provide the correct primary structure for the following nonapeptide. If any of the amino acid…

A:

Q: What is the missing reactant R in this organic reaction? N H3O+ + R + H • Draw the structure of R in…

A: Step 1:Due to the presence of nucleophilic carbon atom, aldehyde reacts with primary amines to form…

Q: 18 1) OH- 2) H+ or OH 7 2 4 3 Br₂ CH₂l₂, Zn/Cu 15 16 14 17 17 1) 03 2) (CH3)2S H₂O, H₂SO4 1)…

A: Step 1: Last one is 18Sorry for bad writing actually the number of questions are too much I have…

Q: None

A: We can convert Kelvin (K) to Celsius (°C) using the following formula:°C = K - 273.15 Here's how to…

Q: What statement is TRUE about the coenzyme? CH O H CC- O NAD Isocitrate Dehydrogenase NACH + H O NAD+…

A: In a chemical reaction, a reducing agent reduces (donates electrons to) another substance, and in…

Q: Can you explain it step by step?

A:

Q: Please provide mechansim. THF quetiapine 0.779-O-TBS CC(C)(C)[SI](C)(C)OCCOCCN1. HCI HCI

A: Describe the initial step of the reaction mechanism, focusing on the interaction between the epoxide…

Q: Please correct answer and don't use hend raiting

A: To calculate the amount of PBS needed to dilute the eluate from an affinity chromatography run, you…

Q: Name the following compounds using IUPAC nomenclature: (include R/S and E/Zdesignations when…

A: Find the longest carbon chain as skeleton.Start numbering from the carbon from where the substituent…

Q: Calculate the pH of a solution made by adding 210 mL of 1.10 M HCI to 375 mL of 1.90 M NH3 solution.…

A: The reaction between hydrochloric acid (HCl) and ammonia (NH3) is a neutralization reaction, where…

Q: 1. What is the major product of the following hydration reaction? о Хон H3O+ H₂O с. d. Огон Тон OH

A: In the presence of an aqueous acid, alkenes usually undergo an electrophilic addition. For this…

Q: None

A: Step 1: Oxidative Atomic Adding The aryl halide or pseudohalide reacts with the palladium(II)…

Q: 74. A voltaic cell employs the redox reaction: Sn²+(aq) + Pb(s) Sn(s) + Pb2+(aq) E° cell = 0.010 V…

A:

Q: Draw the major product of this reaction. Ignore inorganic byproducts. 1. Hg(Cl)2, CH3OH 2. NaBH4,…

A:

Q: Naming complex ions Write the chemical formula of the following metal complexes or complex ions:…

A: 1:Tetramminedicyanozinc(II) :Ligands are ammine (NH3) and cyano (CN-)Tetra means 4.di means…

Q: QUESTION 19 Based on the structure shown below, what is the formal charge on the sulfur? 2- :O-S=0…

A: The formal charge of an atom in a molecule is the hypothetical charge the atom would have if we…

Q: Consider the following reaction where Kp = 0.365 at 1150 K: 2502(g) + O2(g) 2503(g) If the three…

A: Solution: 2SO2​(g)+O2​(g)<−−>2SO3​(g)      and  Kp​=0.365Now lets calculate the…

Q: 4. If some of the calcium metal remains unreacted when you start the titration, the calcium will…

A: During the titration, you're trying to determine the amount of acid needed to neutralize the calcium…

Q: Consider the following reaction at 298K.Sn2+ (aq) + 2 Fe2+ (aq)  Sn (s) + 2 Fe3+ (aq)Which of the…

A: First, we need to determine whether the reaction is product-favored or reactant-favored. This can be…

Q: This question has two parts. a. Calculate the pH of the solution resulting from the addition of 15.0…

A: First, we need to calculate the moles of HCl and aniline. The number of moles is calculated by…

Q: Can you explain it step by step?

A: Given:pOH of the soft drink = 8.53 To find the concentration of [H3​O+] The pH of this drink is…

Q: For the titration of 30.00mL of 0.120M aqueous solution of ammonia (NH3) with 0.200MHCI, calculate…

A: In the process of titrating a 0.120 M aqueous solution of ammonia (NH₃) with 0.200 M hydrochloric…

Q: 3. The transformation can be performed using what? OH Ethanol HO OH Ethylene glycol

A: Step 1: Alcohol went to the process of dehydration to produce alkene.Step 2: Alkelene went to the…

Q: Please answer both questions!!!Make sure its legible!!

A: Step 1: Question No. 6  Step 2:  Question No. 6

Q: Write the decay series for Th-232 undergoing the sequential decays: a, ß, ß, positron emission, a.…

A: Step 1:1. Alpha Decay: In alpha decay, a heavy nucleus emits an alpha particle, which consists of…

Q: ? The following table shows the values of ionization constants for a number of acids and bases at 25…

A: To calculate the ratio of the masses of the buffer components (ammoniaNH3​ and ammonium chloride (…

Q: None

A: PV = nRTWhere:The gas's pressure, expressed in atm, is P.The gas's volume, expressed in liters, is…

Q: Draw the structure(s) of the major organic product(s) obtained after workup of the following…

A: Step 1:The given reaction is an example of an elimination reaction. Since there is no anion…

Q: Which ones are aromatic?

A: There are four rule to identifying aromaticity of a compound:The molecule is cyclic (a ring of…

Q: Which of the following is correct for the H-N-H bond angles in N₂H4 and NH4'? OH-N-H bond angle in…

A: N2H4Let's use the Molecular Geometry A- NitrogenX- Atoms AttachedN- Lone pair electronsThe atoms…

Q: 1. Briefly describe the mechanism and give the rate law for the nucleophilic Substitution of…

A: as per my understanding this is the answer but still  any further queries regarding the answer then…

Q: 1. You are a chemical engineer that is responsible for synthesizing a new drug. You look at a series…

A: 2. Using  LeChatleir's principle, the direction of reaction and magnitude of K can be altered. The…

Q: Predict the major products of this reaction: NaOH → ? A If there won't be any products, just check…

A: Step 1:The reaction proceeds via aldol condensatation mechanism which takes place in presence of an…

Q: Correct each molecule in the drawing area below so that it has the condensed structure it would have…

A: At 0.1 M HCl, the pH is 1 which is highly acidic.The first compound is aminoacetone, which exists at…

Q: Please draw the MO diagram of the linear molecule ML 2 , showing the metal atom on the left and…

A: Here's a breakdown of how to construct and understand the MO diagram for a linear ML2 molecule: 1.…

Q: If the Ka for acetic acid is 1.8x10^-5, what is the Kb for acetate ion? a) 5.6x10^-4 b) 5.6x10^-10…

A: Given: Acetic acid (CH3COOH) Ka = 1.8 x 10-5  Required: Kb of acetate ion, CH3COO−  Solution: Step…

Q: It's a homework I did but I would like to compare my answers please explain your choice

A: If you find anything wrong then please let me know,I will try to correct it.

Q: liquid nitrogen is cold and can be used to cool objects to -196 celcius. if you put the bottle of…

A: To calculate the volume of air in the bottle when it's cooled to -196°C, we need to use the ideal…

Q: ← + 5 2 QT ΑΙ 1. SECTION A Answer BOTH questions in this section (Each question is worth 20 marks)…

A: Detailed explanation:(a)(i) Spectrum of activity:The spectrum of activity of an antibiotic is…

Q: Catalytic converters are the most common option for controlling emissions of polluting gases by…

A: Step 1:Power of concentration term of a reactant in the rate law is equal to the order of reaction…

Q: None

A: Step 1: Step 2: Step 3: Step 4:

Q: Consider the following half-reactions: Half-reaction E° (V) F2(g) + 2e-  2F-(aq) 2.870V…

A:

Q: Write the systematic name of each organic molecule: structure CH3 ☐ CH3 C=CH2 CH3 CH3 CH-CH2-CH=CH2…

A: Step 1: Step 2: Step 3: Step 4:

Q: [References] When 18.0 L of water is added to 6.0 L of 6.0 M H2SO4, what is the molarity of the…

A:

Q: Draw the organic reagents necessary to synthesize the following compound by an aldol condensation.

A: Step 1: Step 2: Step 3: Step 4: