Answered: 5. Which of the following samples has…

5. Which of the following samples has the least moles of the compound 050g of Na₂0 O50g of CO2 075g of BeO 200g of C03 04 O100g of KHSO3

Introductory Chemistry: A Foundation

8th Edition

ISBN:9781285199030

Author:Steven S. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Donald J. DeCoste

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 26QAP

See similar textbooks

Related questions

Q: 1. How many g is present in a sample having 4.52 moles of CaCO3? 2. Methanol burns in air to form…

A: 1) Molar mass of the substance is the weight of one mole of the substance. Molar mass of CaCO3 =…

Q: A model of the butanal molecule is shown in the window below. ball & stick + labels ited a. How many…

A: From the model, Butanal=> CH3>CH2CH2CHOMolecular formula of butanal is C4H8O. Mole is the SI…

Q: If you have 42.5 moles of glucose (C6H₁206) approximately how many grams do you have? #3

Q: 2 Mg(s) + 3 N2 (g) --> 2 MgN3 (s) How many moles of N2 will be used to produce 115 grams of MgN3?

A: The given reaction is, 2 Mg(s) + 3 N2 (g) --> 2 MgN3 (s) We have, mass of MgN3 = 115…

Q: 2S(s) + 3O2(g) --> 2SO3(g) how many moles of SO3 can be produced from 7.2 g O2 and excess S?

A: The balanced reaction taking place is 2 S (s) + 3 O2 (g) --> 2 SO3 (g)

Q: Given the unbalanced chemical equation, CH3OH(1) + O2(g) → CO2(g) + H2O(g), what is the mole ratio…

A: GIVEN Unbalanced reaction: CH3OH (l) + O2 (g) ------> CO2 (g) + H2O (g) Since there are 4 H atom…

Q: A compound containing only hydrogen and carbon is burned in excess O2(g) to produce a total mass of…

A: Given: The compound is formed by carbon and hydrogen only. When the compound is burned in excess…

Q: Convert 0.2377 grams of carbon into moles. 0.01718 molescarbon 0.01181 molescarbon 0.008229…

A: The mass of carbon given = 0.2377 g Molar mass of carbon = 12.0107 g/mol

Q: An excess of Al and 6.0 mol of Br, are reacted according to the equation 2Al + 3Br, 2A|Br; How many…

A: We know the amount of formation of product is always accordingly the limiting reagent. Here Al is in…

Q: Calculate the number of moles of products of the combustion of C3H8 abundance equal to 1.8

Q: C6H8 + O2 ------à CO2 + H2O How many moles of O2 are needed to form 60…

Q: N2 + O2 —> 2NO How many grams of N2 are required to produce 6 moles of NO?

A: In order to calculate the mass of NO firstly we need to calculate molar mass of NO then we can…

Q: How many g of C4H4S2 are equivalent to 5.40 moles of this compound?

A: Answer: 627.48 g

Q: Determine the moles of NH4NO3 in the sample. The molecular weight of NH4NO3is 80.0 g/mol.…

A: Moles = given mass / molecular mass

Q: N2 + O2 —> 2NO What mass of NO is formed when 120 g of N2 react with an excess of O2

A: The balanced Chemical Reaction between Nitrogen and oxygen given in question as - N2 + O2 ----->…

Q: re each number. Column A Column B 1. What is the mass of 0.042 mole C8H18? 2. How many moles are…

A: 1) Calculating the mass of 0.042 moles C8H18:

Q: Consider the chemical reaction N2 + 3H2 = 2NH3 If one begins with 0.25 mole N2 and excess…

Q: If 0.274 moles of a substance weighs 62.5 g, what is the molar mass of the substance, in units of…

Q: Complete combustion of a 1.448 g sample of a hydrocarbon (only carbon and hydrogen present),…

A: Given -> Weight of hydrocarbon = 1.448 gm Weight of CO2 = 3.128 gm Weight of H2O = 1.121 gm

Q: . How many moles of Al(C 2 H 3 O 2 ) 3 contain 19mol O ? 6. Determine the % composition by mass of…

Q: An alloy is found to be 41.8% Zn and the rest is Cu. If 15.0 g of Cu is added to 45.0 g of This…

A: Mass of the alloy = 45g% of copper in the alloy = (100-41.8) = 58.2%% of zinc in the alloy =…

Q: How many grams of NO2 are needed to make 1.5 g of N2?

A: Given :- mass of N2 = 1.5 g To calculate :- mass of NO2 (in grams)

Q: The molecular formula of acetylsalicylic acid (aspirin), one of the most commonly used pain…

Q: Mg(s) + 3 N2 (g) --> 2 MgN3 (s) How many grams of N2 will be used to produce 85.5 moles of MgN3?

A: We have given that The balance chemical equation : 2Mg(s) + 3N2(g) -------> 2MgN3(s)

Q: 1. How many g is present in a sample having 4.52 moles of CaCO3? 2. Methanol burns in air to form…

Q: Calcium sulfateis a white crystalline powder. Gypsum is a mineral, or natural substance, it is a…

Q: 5. Chloral hydrate (C2H3C1302) is a drug formerly used as a sedative and hypnotic. It is a compound…

A: Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: In the following chemical reaction, Determine the number of moles in MH3 from 2.50 moles of H2…

Q: N2 + 3H2 ⟶⟶ 2NH3 How many moles of NH3 can be produced from 6 moles of H2?

Q: 4. How many moles of oxygen are used when 2.22 moles of carbon dioxide are produced? 10 6 c 11_0₂…

A: Answer:When a hydrocarbon is burned in presence of oxygen and formation of water and CO2 takes…

Q: Balance the following equation. ___N2H4(g) + ___H2O2(g) → ___N2(g) + ___H2O(g)

A: A chemical reaction is balanced when each element involved in the reaction has the same number of…

Q: How many moles of K₂ CrO4 are in 65.01 g K₂ CrO4? 65.01 g K₂ CrO4 = How many moles of CaC₂O4 H₂O are…

A: Answer: Both the questions are based on the relation between mass, molar mass and number of moles of…

Q: Given the following chemical equation: 2 Mg(s) + 3 N2 (g) --> 2 MgN3 (s) How many grams of MgN3 will…

Q: 2H2O(g) ----> 2H2 (g) + O2 (g) how many grams of O2 can be produced from 60.3 g H2O(g)

A: The given reaction is: Here, the water vapor (H2O) and oxygen (O2) are in 2:1 stoichiometric ratio…

Q: How many moles of H3PO4 are produced when 71 g of P4010 reacts completely? P4010(s) + 6H,0()-…

A: We have given that Mass of P4O10 = 71g Reaction : P4O10(s) + 6H2O(l) ----> 4H3PO4(aq)…

Q: What mass of CCI4 is formed by the reaction of 5.14 g of methane (CH4) with an excess of chlorine?

A: Given :- mass of CH4 = 5.14 g To calculate :- mass of CCl4 produced Molar mass of CCl4 is 153.82…

Q: What number of molecules (or formula units) are present in 2.25 g of each of the following…

Q: Convert

A: Moles of H2O2 = ( number of molecules of H2O2 / Avagadro number ) Where : number of Molecules of…

Q: C4H10O+6O2=4CO2+5H2O How many grams of carbon dioxide are formed from 4.75g O2

A: Molar mass of carbon dioxide = 44.01g/mol

Concept explainers

Mole Concept

Mole concept is a method to determine the amount of any substance that consists of some elemental particles using a grouping unit called ‘mole’. The mole concept enables one to handle the large amount of small elementary particles. The mole concept can be used in many calculations related to mole calculation, molar amount, mole ratio, and so on, which are significant in chemistry.

Question

ome
The Leading...
O 200g of Co3 04
O100g of KHSO3
My Home
5. Which of the following samples has the least moles of the compound?
050g of Na₂0
O50g of CO₂
075g of BeO

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1: List the Given Data

VIEW

Step 2: Find the Moles of All the Compounds

VIEW

Solution

VIEW

Step by step

Solved in 3 steps with 6 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Copper(I) iodide (CuI) is often added to table salt as a dietary source of iodine. How many moles of CuI Are contained in 1.00 lb (454 g) of table salt containing 0.0100% CuI by mass?
DDT, an insecticide harmful to fish, birds, and humans, is produced by the following reaction: In a government lab, 1142 g of chlorobenzene is reacted with 485 g of chloral. a. What mass of DDT is formed, assuming 100% yield? b. Which reactant is limiting? Which is in excess? c. What mass of the excess reactant is left over? d. If the actual yield of DDT is 200.0 g, what is the percent yield?
How are the molecular mass and the molar mass of a compound similar and how are they different?
Sodium borate decahydrate, Na2B4O710H2O is commonly known as borax. It is used as a deodorizer and mold inhibitor. A sample weighing 15.86 g is heated until a constant mass is obtained indicating that all the water has been evaporated off. (a) What percent, by mass of Na2B4O710H2O is water? (b) What is the mass of the anhydrous sodium borate, Na2B4O7?
The empirical formula of a gaseous fluorocarbon is CF2 . At a certain temperature and pressure, a 1-L volume holds 8.93 g of this fluorocarbon, whereas under the same conditions, the 1-L volume holds only 1.70 g gaseous fluorine (F2) . Determine the molecular formula of this compound.
An air bag is deployed by utilizing the following re tion the nitrogen gas produced inflates the air bag): :math>2NaN3(s)2Na(s)+3N2(g) 10.5 g of NaN1 is decomposed, what theoretical mass of sodium should be produced? If only 2.84 g of sodium is actually collected, what is the percent yield?
A chemist prepared a compound that she thought had the formula FeI3. When the compound was analyzed, it contained 18.0% Fe and 82.0% I. Calculate the mass percentage composition expected for FeI3 and compare the result with that found in the analysis. Is this the correct formula of the compound?
When elemental carbon is burned in the open atmosphere, with plenty of oxygen gas present, the product is carbon dioxide. :math>C(s)+O2(g)CO2(g) wever, when the amount of oxygen present during the burning of the carbon is restricted, carbon monoxide is more likely to result. :math>2C(s)+O2(g)CO(g) at mass of each product is expected when a 5.00-g sample of pure carbon is burned under each of these conditions?
What mass of compound is present in 5.00 moles of each of the compounds in Exercise 5 1?
When 9.59 g of a certain vanadium oxide is heated in the presence of hydrogen, and a new oxide of vanadium are formed. This new vanadium oxide has a mass of 8.76 g. When the second vanadium oxide undergoes additional heating in the presence Of hydrogen, 5.38 g of vanadium metal forms, a. Determine the empirical formulas for the two vanadium oxides. b. Write balanced equations for the Steps of the reaction. c. Determine the mass of hydrogen needed to complete the steps of this reaction.
Solid calcium carbide (CaC2)reacts with liquid water to produce acetylene gas (C2H2)and aqueous calcium hydroxide. l type='a'> Write the balanced equation for the reaction that is (occurring. including all phases. If a 100.0-g sample of calcium carbide (CaC2)is initially reacted with 50.0 g of water, which reactant is limiting? Prove that mass is conserved for the reactant amounts used in pan b.
or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)