5. The product for the reaction below is: CH;CH=CH2 + HCI → a) CH3CHCICH3 b) CH3CH2CH2CI c) CH3CHCICH2CI d) CH2CICHCICH2CI

Q: What is the major product for the following reaction? на Д CH-CH-CH₂CH₂ он- OH 0 CH—CH-CH;CH3 OCI 0…

A: An arrow always depicts from a region of high electron density to low electron density ; that is…

Q: Predict the product(s) for the following reaction. Oll + enantiomer I OI ||| OH O IV OH CN "OH +…

A: The question is based on organic reactions.     we need to identify the product formed and explain…

Q: Draw the major product of this reaction. Ignore inorganic byproducts. CH3CH2C(O)CH2CH3 pH 4-5 N H…

A: In the first step of this reaction, ketone react with secondary amine in presence of acid condition…

Q: 2) What is the product of the following reaction? 2 CH CH CH A) OH CHICHI CHICH CH₂ B) CHICHI CHICH…

A:

Q: please help Draw the product (s) formed when cyclohexene is treated with this reagent

A: (h) We have to draw the structure of the product formed when cyclohexene is treated with BH3…

Q: Draw the product(s) for the following reaction.

A: The given reactant is a triester. It reacts with sodium hydroxide (NaOH) resulting in the formation…

Q: t-BUOK -> A is the reacich SN1,SN2 ET or E2 and wnat is the Br majar product. er EtONa

A:

Q: Name the following compounds: CH Hex ane a) HạC CH3 CH2 CH2 -CH3 1- PropyI -6 - butYICYclononene H3C…

A:

Q: Explain why the following reaction leads to the products shown:

A: The reaction of aliphatic amines with nitrous acid (HNO2) is a useful test for differentiating…

Q: 5) What is the product of the following reaction? A) D) CI OH (CH3CH₂CH₂)2CuLi H30 B) OH OH

A: Gilman reagent reacts with acid chloride to form ketone.

Q: Br Br Br Starting material product Reagents available • CH z Iz, Zn Ccu) •HC=C:- • Hz, lindlar…

A:

Q: To which category does the following reaction belong? -CH₂CH₂CI+ OH- elimination substitution…

A: We have to tell the type of the reaction.

Q: CH2-0-C-(CH2)4CH=CHCH,CH=CH(CH2); CH3 3 H2 CH-O-C-(CH2)4CH=CH(CH2)2CH3 Pt ČH2-0-C-(CH2)4CH3

A: Hydrogenation of lipids

Q: ∙OH B H ₂ SO 4 с D

A: The answer to the following question is-

Q: CHal2 Zn/Cu H3C A В H3C Znl D

A: Given

Q: 12) What is the major product of the following reaction? CH: CH: 2 OH CH-CH-CH;-CH-CH CH: CH: Br Br

A: During elimination, more stable alkene is predominantly formed. Conjugated alkene is more stable…

Q: 35) Draw the major product of the following reaction: 1. R₂BH 2. H₂O2, OH C=C-H

A: Given an alkene and reagent . Draw the product.

Q: Write the following reactions by explaining the mechanism; Explain the stereochemistry at each step.…

A: Carbonyl centre is electrophilic in nature so favours nucleophilic attack .

Q: (b) CH3 1. DIBAH CH3CHCH2CH2CO2CH3 2. H30* (d) CO2H CH3OH, ? H2SO4 CH3 он CH;CO,COCH3. Рyпidine (h)

A: Answer  Draw the product of the following reaction

Q: 4. What is the expected product of the following reaction? A) OCH 3 B) OH CH 3 C) CH3OH H+ OCH 3 D)…

A: Here  protonation occur at 3 position because  the generated carbocation is stabilized by  2p-2p…

Q: b) CH3 H₂C NBS Δ -CH₂ AICI3 HO™ Br₂ FeBr 3 H3C AICI 3 CrO. H₂SO

A: NBS is a source of Br radical . OH- acts as a nucleophile then Friedalcraft acylation .…

Q: Draw the products of each reaction, and indicate the stereochemistry where appropriate. With…

A:

Q: NaH CH;CH2I i. HO CH2CH3

A:

Q: Fill in the missing products and intermediates

A: Find the missing products and intermediates .

Q: Which is the major product of this reaction? но heat + H2SO4 X a) b) c) d)

A:

Q: What is the major product of the following reaction? PCI 3 pyridine CH—CH–CH;CH3 CHỊCH OH I)…

A: PCl3 phosphorus chloride act as chlorinating agent. Overall reaction OH is replaced by Cl

Q: Give the major product of the following reaction. 1) NANH2 2) CH3CH2CI, O There is no reaction under…

A: Given incomplete reaction is : What will the major product = ?  Options are :

Q: c. Identify a,b,c, and d a %3D CH3-CH2-C-O-CH3 CH;CH2CHO OJZn/CH;COOH b+ C Ether d Li(CH3)2Cu/H30*

A:

Q: What is the configuration of this alkene? CI X Trans E OZ Neither E nor Z

A: we assign priorities to different substituents present across double bonds based on CIP rules.When…

Q: #2 - Draw the step-by-step mechanism for each of the steps in the following reaction sequence. Be…

A:

Q: 18) Predict the product. 2CH₂CH3 Brz CH3CO₂ H

A: A ketone is brominated by Br2 in the presence of an acid, e.g., acetic acid.In this reaction, an…

Q: + H₂C=CHCI heat Eto EtOH Consider the above reaction and draw the structures of products a and b. b

A:

Q: The major product of the following reaction is: CH;CH,S¯ Na CH;CHCH,CH,Br DMSO CH3 CH;CHCH=CH, CH3…

A: Nucleophilic substitution reaction is a class of organic reactions where one nucleophile replaces…

Q: ⑤Draw the products for the following reactions. CH 유 -(CH2) 4-CH=CH-CH2-CH=CH-CH2-CH=CH(CHI)y CH3…

A:

Q: Which alkene reacts with methanol in presence of acid catalyst to give the following ether? CH3…

A:

Q: CH3 СНОН || "CH2CH3 + CH CI

A: The major and minor products of the given reaction is shown below,

Q: K Br B ÕH (-H,) TSCI, pyr O`Na* C D

A: Given reactions are :  Write structures for products A, B, C, and D, showing stereochemistry = ?

Q: What are the major products obtained from the following reactions? Indicate the geometry…

A: Both reaction is electrophilic addition reaction in which multiplee bond will break and electrophile…

Q: What reagent would you use to carry out the following reaction? I CH3CH₂ A) CH3OH/H* B) CH4 C)…

A: The given reaction is a example of esterification.In this reaction propanoic acid is converted to…

Q: Give the final major product from the following reaction. H₂O CH₂OH major product? Give the final…

A: Butyl lithium behaves as nucleophile as well as base. When butyl lithium mixed in aqueous methanolic…

Q: 3. Which of the following is the A) Br Br

A: This reaction is the addition of HBr to 1,3-diene. This addition takes place either 1,2 or 1,4 -…

Q: What is the major product of the reaction below? 2 HCI CH;CH2C=CH

A:

Diol

In chemistry there are so many chemical compounds that have a hydroxyl group but a chemical compound having two hydroxyl groups (-OH) is termed as a diol. It also implies the presence of two alcohols whereas polyols contain two or more than two hydroxyl groups (-OH). Glycol or 1,2-diol is an aliphatic diol that has two alcohol groups on adjacent carbon atoms. In industries, the most commonly used diol is ethylene glycol.