Answered: 5. Calculate the standard cell…

Science

Chemistry

5. Calculate the standard cell potential, E cell, for each electrochemical cell at 298K if Keg=1.38 x10$ and n = 2

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter17: Electrochemistry And Its Applications

Section: Chapter Questions

Problem 50QRT

See similar textbooks

Related questions

Q: The standard cell potential for the reaction: A (s) + B2* (aq) = A2* (aq) + B (s) is - 0.371 V. What…

Q: Calculate the cell potential for the galvanic cell in which the given reaction occurs at 25 °C,…

A: [Co2+]=0.00190 M[Au3+]=0.896 MT=25oC=25+273=298K

Q: A current of 0.452 A is passed through an electrolytic cell containing molten CaCl2 for 1.50 hours.…

Q: Calculate the cell potential of each of the following electrochemical cell at 25oC. b. Pt|H 2 (1.00…

A: pH = 5.97 at Anode pH = 3.47 at cathode

Q: Calculate the standard cell potential, E cells for each electrochemical cell given the following…

Q: Calculate the non-standard cell potential (in V) for the following reaction at 178.7℃ with the…

Q: The cell notation for the Galvanic cell is A(s)/A2+//B2(s)/B- The Standard Reduction…

Q: Calculate the cell potential for the reaction as written at 25.00 °C, given that [Mg² +] = 0.755 M…

A: Given,

Q: Calculate the potential of the electrochemical cell and determine if it is spontaneous as written at…

Q: A current of 0.452 Amps is passed through an electrolytic cell containing molten CaCl2 for 1.50 hrs.…

Q: A galvanic (voltaic) cell consists of an inert platinum clectrode in a solution containing 1.0 M…

Q: What is E at 25 °C for the reaction described by Mg(s) | Mg²⁺ (1.60 M) || Pb²⁺ (0.850 M) | Pb(s)?…

A: Mg(s) | Mg²⁺ (1.60 M) || Pb²⁺ (0.850 M) | Pb(s) Standard cell potential (E°cell) = +2.231 V Cell…

Q: Calculate the cell potential for the reaction as written at 25.00 °C, given that [Zn2+] = 0.875 M…

A: The given cell reaction is : Zn2+=0.875 MFe2+=0.0200 M

Q: Consider the cell below at standard conditions: Zn(s) | Zn 2+ (aq) || Fe 2+ (aq) | Fe(s) Calculate…

Q: 12 The standard cell potential for the following galvanic cell is 0.71 V.…

A: Given- Standard cell potential of galvanic cell =0.71V Mg(s)|Mg2+(aq)||Al3+(aq)|Al Equilibrium…

Q: Calculate the cell potential for the galvanic cell in which the given reaction occurs at 25 °C,…

A: Answer: Cell potential for the given Galvanic cell can be calculated using Nernst equation as shown…

Q: A galvanic (voltaic) cell consists of an inert platinum electrode in a solution containing 1.0 M…

A: Cell made-up of two couples Cr(III)/Cr(II) and Co(III)/Co(II) The standard potential of cell can be…

Q: A Ni Ni 2+Ag Ag + galvanic cell is constructed in which the standard cell potential is 1.03 V.…

A: cell potential = 1.03 V wt of silver deposited= 1g Free energy : The maximum work a system can…

Q: The standard cell potential for the reaction shown here is 0.653 V. Calculate the cell potential at…

A: We have given that Ecell° = 0.653 V And net reaction as follow 2Hg(aq)2+ + 2V(aq)2+ ⇋…

Question

5.
Calculate the standard cell potential, E
cell, for each electrochemical cell at 298K if
Keg= 1.38 x10-5 and n = 2

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Table 17-1 lists common half-reactions along with the standard reduction potential associated with each half-reaction. These standard reduction potentials are all relative to some standard. What is the standard (zero point)? lf is positive for a half-reaction, what does it mean? If is negative for a half-reaction, what does it mean? Which species in Table 17-1 is most easily reduced? Least easily reduced? The reverse of the half-reactions in Table 17-1 are the oxidation half-reactions. How are standard oxidation potentials determined? In Table 17-1, which species is the best reducing agent? The worst reducing agent? To determine the standard cell potential for a redox reaction, the standard reduction potential is added to the standard oxidation potential. What must be true about this sum if the cell is to be spontaneous (produce a galvanic cell)? Standard reduction and oxidation potentials are intensive. What does this mean? Summarize how line notation is used to describe galvanic cells.
From the standard potentials Ag2SeO4(s)+2e2Ag(s)+SeO42-E0=0.355V Ag++2eAg(s)E0=0.799V calculate the solubility product constant for Ag2SeO4.
From the standard potentials Tl++eTl(s)E0=0.336V TlCl(s)+eTl(s)+ClE0=0.557V calculate the solubility product constant for TlCl.
Calculate the standard cell potential of the following cell at 25C. Sn(s)Sn2+(aq)I2(aq)I(aq)
The standard potential, E, for the reaction of Zn(s) and Cl2(g) is +2.12 V. What is the standard free energy change, rG, for the reaction?
The table below lists the cell potentials for the 10 possible galvanic cells assembled from the metals A. B. C. D. and E. and their respective 1.00 M 2+ ions in solution. Using the data in the table, establish a standard reduction potential table similar to Table 17-1 in the text. Assign a reduction potential of 0.00 V to the half-reaction that falls in the middle of the series. You should get two different tables. Explain why, and discuss what you could do to determine which table is correct. A(s)in A2+(aq) B(s)in B2+(aq) C(s)in V2+(aq) D(s)in D2+(aq) E(s)in E2+(aq) 0.28V 0.81V 0.13V 1.00V D(s)in D2+(aq) 0.72V 0.19V 1.13V C(s)in V2+(aq) 0.41V 0.94V B(s)in B2+(aq) 0.53V
What is the standard cell potential you would obtain from a cell at 25C using an electrode in which I(aq) is in contact with I2(s) and an electrode in which a chromium strip dips into a solution of Cr3(aq)?
It took 150. s for a current of 1.25 A to plate out 0.109 g of a metal from a solution containing its cations. Show that it is not possible for the cations to have a charge of 1+.
Calculate the cell potential of a cell operating with the following reaction at 25C, in which [MnO4] = 0.010 M, [Br] = 0.010 M. [Mn2] = 0.15 M, and [H] = 1.0 M. 2MNO4(aq)+10Br(aq)+16H+(aq)2MN2(aq)+5Br2(l)+8H2O(l)
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
Galvanic cells harness spontaneous oxidationreduction reactions to produce work by producing a current. They do so by controlling the flow of electrons from the species oxidized to the species reduced. How is a galvanic cell designed? What is in the cathode compartment? The anode compartment? What purpose do electrodes serve? Which way do electrons always flow in the wire connecting the two electrodes in a galvanic cell? Why is it necessary to use a salt bridge or a porous disk in a galvanic cell? Which way do cations flow in the salt bridge? Which way do the anions flow? What is a cell potential and what is a volt?
Calculate the standard cell potential of the cell corresponding to the oxidation of oxalic acid, H2C2O4, by permanganate ion. MnO4. 5H2C2O4(aq)+2MnO4(aq)+6H+(aq)10CO2(g)+2Mn2+(aq)+8H2O(l) See Appendix C for free energies of formation: Gf for H2C2O4(aq) is 698 kJ.