5 g of hydrated barium chloride is heated in a crucible until the mass of the sample no longer changes. The mass of the sample after heating is 4.26 g. Assume that the mass lost during the heating is solely due to the loss of water from the sample. How many moles of water were removed from the hydrate?

5 g of hydrated barium chloride is heated in a crucible until the mass of the sample no longer changes. The mass of the sample after heating is 4.26 g. Assume that the mass lost during the heating is solely due to the loss of water from the sample. How many moles of water were removed from the hydrate?

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter3: Stoichiometry

Section: Chapter Questions

Problem 117E: Bacterial digestion is an economical method of sewage treatment. The reaction is an intermediate...

See similar textbooks

Similar questions

Calculate the molarity of solutions prepared by dilution or calculate the quantities needed to carry out a dilution to prepare a solution of a specified concentration.
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?
What does it mean to say an equation is balanced? Why is it important for an equation to be balanced?
What mass of solid NaOH (97.0% NaOH by mass) is required to prepare 1.00 L of a 10.0% solution of NaOH by mass? The density of the 10.0% solution is 1.109 g/mL.
The space shuttle environmental control system handles excess CO2 (which the astronauts breathe out; it is 4.0% by mass of exhaled air) by reacting it with lithium hydroxide, LiOH, pellets to form lithium carbonate, Li2CO3, and water. If there are seven astronauts on board the shuttle, and each exhales 20. L of air pee minute, how long could clean air be generated if there were 25,000 g of LiOH pellets available for each shuttle mission? Assume the density of air is 0.0010 g/mL.
Nitric acid is produced commercially by the Ostwald process, represented by the following equations: 4NH3(g)+5O24NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(aq)+NO(g) What mass of NH3 must be used to produce 1.0 106 kg HNO3 by the Ostwald process? Assume 100% yield in each reaction, and assume that the NO produced in the third step is not recycled.
Calculate the amounts of reactants needed in a chemical reaction to produce a specified amount of product.
Silicon is produced for the chemical and electronics industries by the following reactions. Give the balanced equation for each reaction. a. SiO2(s)+C(s)Si(s)+CO(g) b. Silicon tetrachloride is reacted with very pure magnesium, producing silicon and magnesium chloride. c. Na2SiF6(s)+Na(s)Si(s)+NaF(s)
Calcium carbonate forms carbon dioxide and calcium oxide when it is heated above 900 °C in a limekiln. When heated to 1000 °C in a laboratory, 4.31 g calcium carbonate produces 2.40 g calcium oxide and 1.90 g carbon dioxide. Outline a method similar to combustion analysis by which you could determine the empirical formula for calcium carbonate from these data. Carry out the determination.
When solutions of silver nitrate and sodium carbonate are mixed, solid silver carbonate is formed and sodium nitrate remains in solution. If a solution containing 12.43 g sodium carbonate is mixed with a solution containing 8.37 g silver nitrate, calculate the mass of each of the four substances present after the reaction is complete.
list at least three quantities that must be conserved in chemical reactions.