3(R),4(R) 3-Bromo-3,4-dimethylhexane CH2CH3 Br -CH3 NaOCH3 in CH3OH heat -CH3 CH2CH3

Q: CH3 CH3 CH3-C-CH=CH2 + H-Cı → CH3-Ċ-CH-CH3 CH3 ČI CH3

A:

Q: Which of the following carbocations would you expect to rearrange? CH3 CH3 CH3 CH3CHCHCH3 + A B C O…

A:

Q: 3. Complete the following reactions: O CH3 (a) CH3CH2C-O-CH + H2O CH3 [O] (b) CH3-CH2-C-H (c)…

A: Step 1:The given reactions are, Step 2:Step 3: Step 4:

Q: CO 20: Convert between names, bond-line structures, Newman and Fischer projections. A Fischer…

A: The answer is given as follows

Q: Draw the structure of the following compounds: [(1E,3E)-hexa-1,3-dien-1-yl]cyclopentane…

A: The structure of the compounds has to be drawn.

Q: Provide the systematic name for the following structure according to IUPAC rules:

A: We have to predict the nomenclature of given structure.

Q: 6. •O CH₂-O-C-(CH2) 14CH3 CH-O-C-(CH₂)7-G C-(CH₂)7CH3 + 3 NaOH water heat…

A: Given an incomplete reaction of fat hydrolysis. Determine the products.

Q: In the following reactions which products are correctly shown? CH3 Br CH2 HBr OH Ether Br NBS hu,…

A: The reaction 2nd show incorrect other product. And all other reaction have their correct product.

Q: + CH;CH2CCH3 CH;CH2CH2CH CH;CH2CH | CH3 H CH3

A: List the following carbocations in each set in order from most stable to least stable:

Q: Draw skeletal structures of the following molecules and show the steps:…

A: 1. Compound 1 is not possible to draw as Carbon atoms generally can't have more than 4 atoms…

Q: Prepare 1-nonen-3-ol from heptanal and acetyle a. CH3(CH2)5CH(OH)-CH=CH2

A: Given is synthesis reaction.

Q: Which of the following carbocations would you expect to rearrange? B, E CH3 A CH3 CH3CCH₂CH3 D A CH3…

A: To solve this problem we have to identify the carbocation which will rearrange it self.…

Q: H,C CH3 H3C- CH3 2,5-dimethyl-hept-3-ene Submit Previous Answers Request Answer X Incorrect; Try…

A: Correct name is , Trans-2,5-dimethyl hept-3-ene

Q: Rings + Unsaturation --- Hydrogenation  If compound A C51H81BrN5O3P3 is hydrogenated to give…

A: THE DEGREE OF UNSATURATION IS GIVEN AS Ring+unsaturation=C-H2+N2-X2-3×P2Where,C=no of carbon…

Q: Give the IUPAC name for the following compound. Be sure to use cis/trans, E/Z or R/S where…

A: RULES for IUPAC nomenclature; In first step, we identify functional groups present.  We make longest…

Q: How many stereoisomers are possible for 10,12-hexadecadien-1-ol? CH3(CH2)2CH=CHCH=CH(CH2)8CH2OH…

A: StereoIsomers are the molecules with a same molecular formula and connectivity between atoms but…

Q: Draw the compunds below. (2e,4z)-1-bromo-4-methylhexa-2,4-diene…

A: Given: (2e,4z)-1-bromo-4-methylhexa-2,4-diene (2e,4z)-5-bromo-3-methylhexa-2,4-diene…

Q: Br Br

A: Rules for IUPAC NAMING:- First of all find a long carbon chain known as parent chain. Then start…

Q: Draw a structural formula for the major organic product of the reaction shown below. ether…

A: The reaction given is,

Q: 1. CH3 1 H3C-CH-O-CH₂CH3 HỌC CHỊCH, 2. CHOO + + H-Br: CH₂=CH-C=CH₂ 3 CH3 1 - H3C-CH-O-CH₂CH3 + H :…

A:

Q: Which of the following choices is the correct name for the structure shown here?…

A: Given: To find The name of the compound

Q: Name the following compound

A:

Q: Which of the following E,Z designations are correct? Mark all correct answers. CO-H (Z) CH-CH=CH,…

A:

Q: CH, B CH, Br CH3 Br CH3 Br CH; Br CH3 Br CH3 Br CH3 Br CH; Br CH3 CH3 CH3 Br Br Br.

A: diastereoisomers are the compounds that are non-mirror images of each other or we can say that the…