2. What is the theoretical yield of sodium oxide if you start with 35g of calcium oxide?NaCI + Cao→CaCl2 + Nazo3. If 8.5 g of sodium carbonate are used to react with tin (IV) phosphate, and the result is73.0%, what is the actual yield of sodium phosphate?Sn3(PO4)4 + 6Na2CO3 > 3Sn(CO3)2 + 4Na3PO4

Answered: Image /qna-images/answer/670dcc99-281e-4ff6-88a9-21711c1a32d6.jpg

Answered: 2. What is the theoretical yield of…

Science

Chemistry

2. What is the theoretical yield of sodium oxide if you start with 35g of calcium oxide? Сао —> NaCI CaCl2 + Na2O

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter5: Stoichiometry

Section: Chapter Questions

Problem 106E: The reaction between potassium chlorate and red phosphorus takes place when you strike a match on a...

See similar textbooks

Similar questions

Ethanol, C2H5OH, is a gasoline additive that can be produced by fermentation of glucose. C6H12O62C2H5OH+2CO2 (a) Calculate the mass (g) of ethanol produced by the fermentation of 1.000 lb glucose. (b) Gasohol is a mixture of 10.00 mL ethanol per 90.00 mL gasoline. Calculate the mass (in g) of glucose required to produce the ethanol in 1.00 gal gasohol. Density of ethanol = 0.785 g/mL. (c) By 2022, the U. S. Energy Independence and Security Act calls for annual production of 3.6 1010 gal of ethanol, no more than 40% of it produced by fermentation of corn. Fermentation of 1 ton (2.2 103 lb) of corn yields approximately 106 gal of ethanol. The average corn yield in the United States is about 2.1 105 lb per 1.0 105 m2. Calculate the acreage (in m2) required to raise corn solely for ethanol production in 2022 in the United States.
You take 1.00 g of an aspirin tablet (a compound consisting solely of carbon, hydrogen, and oxygen), burn it in air, and collect 2.20 g CO2 and 0.400 g H2O. You know that the molar mass of aspirin is between 170 and 190 g/mol. Reacting 1 mole of salicylic acid with I mole of acetic anhydride (C4H6O3) gives you 1 mole of aspirin and 1 mole of acetic acid (C2H4O2). Use this information to determine the molecular formula of salicylic acid.
The carbon dioxide exhaled in the breath of astronauts is often removed from the spacecraft by reaction with lithium hydroxide 2LiOH(s)+CO2(g)Li2CO3(s)+H2O(l) Estimate the grams of lithium hydroxide required per astronaut per day. Assume that each astronaut requires 2.50 103 kcal of energy per day. Further assume that this energy can be equated to the heat of combustion of a quantity of glucose, C6H12O6, to CO2(g) and H2O(l). From the amount of glucose required to give 2.50 103 kcal of heat, calculate the amount of CO2 produced and hence the amount of LiOH required. The H for glucose(s) is 1273 kJ/mol.
The sugar sucrose, which is present in many fruits and vegetables, reacts in the presence of certain yeast enzymes to produce ethanol and carbon dioxide gas. Balance the following equation for this reaction of sucrose. C12H22O11(aq) + H2O(l) C2H5OH(aq) + CO2(g)
(a) Butane gas, C4H10, can burn completely in air [use O2(g) as the other reactant] to give carbon dioxide gas and water vapor. Write a balanced equation for this combustion reaction. (b) Write a balanced chemical equation for the complete combustion of C3H7BO3, a gasoline additive. The products of combustion are CO2(g), H2O(g), and B2O3(s).
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
3.14 A number of compounds are used in cement, and reactions among them occur when water is added. In one, CaO reacts with Al2O3 and water to form Ca3Al2(OH)12. Write a bal- anced chemical equation for this process.
One of the ways to remove nitrogen monoxide gas, a serious source of air pollution, from smokestack emissions is by reaction with ammonia gas, NH3. The products of the reaction, N2 and H2O, are not toxic. Write the balanced equation for this reaction. Assign an oxidation number to each element in the reactants and products, and indicate which element is oxidized and which is reduced.
Nitric acid is produced commercially by the Ostwald process, represented by the following equations: 4NH3(g)+5O24NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(aq)+NO(g) What mass of NH3 must be used to produce 1.0 106 kg HNO3 by the Ostwald process? Assume 100% yield in each reaction, and assume that the NO produced in the third step is not recycled.
4.69 The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH. The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
Write a balanced equation for (a) the combustion (reaction with oxygen gas) of glucose, C6H12O6, to give carbon dioxide and water. (b) the reaction between xenon tetrafluoride gas and water to give xenon, oxygen, and hydrogen fluoride gases. (c) the reaction between aluminum and iron(III) oxide to give aluminum oxide and iron. (d) the formation of ammonia gas from its elements. (e) the reaction between sodium chloride, sulfur dioxide gas, steam, and oxygen to give sodium sulfate and hydrogen chloride gas.
4.8 In an experiment carried out at very low pressure, 13x1015 molecules of H2 are reacted with acetylene, C2H2, to form ethane, C2H6, on the surface of a catalyst. Write a balanced chemical equation for this reaction. How many molecules of acetylene are consumed?