19.1 Give the IUPAC name for the following structures. OH OH

22.2 Give the structure of the alkyl halide used in the reaction shown below. 1. LDA 2. R-Br or

Methylparaben is a common preservative used in cosmetics. What carboxylic acid and alcohol are needed to synthesize methylparaben by Fischer esterifi cation?

Draw the product formed when phenylacetic acid (C6H5CH2COOH) is treated with each reagent. With some reagents, no reaction occurs. (A - F)

which compound can be classified as an Acetal OH a) b) OH (c) Y d)

17.54 What ester is formed when each carboxylic acid is treated with 2-propanol [(CHCHOH] in the presence of H,SO,? a. CH3CH,COOH c. HCO2H b. d. CH30- -COOH CH3(CH2)10 CHO.

Carboxylic Acids

Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple.  Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 7.30 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures.   Part B A chemist ran the reaction and obtained 5.95 gg  of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures.   Part C The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 7.30 gg of…

Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple.  Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.45 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures.   A chemist ran the reaction and obtained 5.50 gg  of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures.   The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 8.45 gg of butanoic acid and excess…

18. Identify the lactone formed by the following hydroxy carboxylic acid. A. A B. B C. C D. D OH OH & & A) B) C) D)