I need help on this? 13) Use Valence Bond Theory to determine the hybridization on the metal for each of thefollowing.a) [Fe(CN)6]³dasliema edisbinsya bnpridigeMawRb) [Ti(H₂O)6]³+c) [PdCl4]²-(29xalqmBiño e sani(29xd) [FeI6]4-evenenossma sved abnsoll bleft-ansnosi si bns barrioodondels bonisq 3 saw enerPresent?gyd alstidio brenni priaonierstiqasbalstido(snel 9151alsidjuo prilau)9399sbinsyo (8Sbibel/7(eI (dpe (11de(EL

Following complex/coordination ions are given -

13) Use Valence Bond Theory to determine the hybridization on the metal for each of the following. a) [Fe(CN)6]³- daliema od ebineya Qulige bre b) [Ti(H₂O)6]³+ c) [PdCl4]²- (29xslamo Vino e'stant sonia hig lagxalomo d) [FeI6]4- sw sma sved si rod als bening a new 91503) Srpsins ons bai Isolgydalstidio b stiqgabalstido b (506) 915upe lebigy alsidho b pnieu) Juo prilau) Shiben? (2 (EL

13) Use Valence Bond Theory to determine the hybridization on the metal for each of the following. a) [Fe(CN)6]³- daliema od ebineya Qulige bre b) [Ti(H₂O)6]³+ c) [PdCl4]²- (29xslamo Vino e'stant sonia hig lagxalomo d) [FeI6]4- sw sma sved si rod als bening a new 91503) Srpsins ons bai Isolgydalstidio b stiqgabalstido b (506) 915upe lebigy alsidho b pnieu) Juo prilau) Shiben? (2 (EL

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter21: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 102CP

See similar textbooks

Similar questions

Give the number of unpaired electrons in octahedral complexes with strong-field ligands for (a) Rh3+ (b) Mn3+ (c) Ag+ (d) Pt4+ (e) Au3+
Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?
Would you expect salts of the gold(I) ion, Au+, to be colored? Explain.
has a crystal field splitting energy, o, of 2.60102 kJ/mol. What is the wavelength responsible for this energy?
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.
10) What is a representative orbital-filling diagram for the cobalt ion in the low spin complex of [Co(CN)6]3-? (A) ↑L_TL TL - - 3d 4.s 4p 4d 3d 4s 4p 4d - 3d 4s 4p 4d - | |
The complex [Fe(H2O)6]+2 exhibits only σ-donor behavior. Using ligand field theory, draw the molecular orbital diagram mixing the d-orbitals on the metal and the molecular orbitals on the ligands and fill in the available electrons. What is the nature of the t2g orbitals that are part of Δo, bonding, antibonding, or non-bonding? Explain your answer.
The complex [Ni(CN)4]2- is diamagnetic but [NiCl4]2- is paramagnetic (both d8), with two unpaired electrons. Similarly, [Fe(CN)6]3- has only one unpaired electron, but [Fe(OH2)6]3+ has 5. Explain these experimental observations using: a) the Valencia Bond Theory. b) the Crystalline Field Theory.
Which of the following species would have the largest crystal field splitting? A) [Co(H,0),]³+ B) [Co(NH3),]** C) [Co(CN),J³- D) [CoCl,J3-
b) [Mn(CN)4]+- Are all Mn-N bond lengths the same in the ion? Explain why