13 4 10 5.50 g of a certain Compound X, known to be made of carbon, hydrogen and perhaps oxygen, and to have a molecular molar mass of 70. g/mol, is burned completely in excess oxygen, and the mass of the products carefully measured: product mass carbon dioxide 17.29 g water 7.08 g Use this information to find the molecular formula of X.

13 4 10 5.50 g of a certain Compound X, known to be made of carbon, hydrogen and perhaps oxygen, and to have a molecular molar mass of 70. g/mol, is burned completely in excess oxygen, and the mass of the products carefully measured: product mass carbon dioxide 17.29 g water 7.08 g Use this information to find the molecular formula of X.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

Payal
Iron oxide reacts with carbon to produce elemental iron and carbon monoxide according the the equation shown below. Consider the reaction of 51.4 grams of Fe2O3 with 24.98 grams of C to produce 19.20 grams of Fe. Fe2O3(s)+3c(s)-------2Fe(s)+3CO(g) a. actual yield b. theoretical yield c. percent yield
In the picture shown, the limited reactant is ____. The excesss reactant is ____. The product of the reaction is ___.
11. Elemental phosphorus, P4, reacts vigorously with oxygen to give P4O10. What is the mass of P4O10 that can be produced if 3.75 g of P4 is reacted with 6.55 g of oxygen? If any reagent was in excess, how much of it will be leftover when the reaction is finished?
A 2.69 gram sample of a KCl and KClO3 mixture was found to contain 0.01268 mol of KClO3. What is the percent by mass of KClO3 in the original mixture? Report your answer with three significant figures.
#11 please
3. Given: NaCl 1 NiCl₂ + 2 NaOH → 1 Ni(OH)₂ + 2 A student combines 2.44 g of NiCl₂ with 6.44 g NaOH. Determine a. The limiting reactant. b. The mass of the excess reactant that remains at the end of the reaction. c. The number of NaCl molecules that are formed if the reaction is 51% efficient.
A student heats a 2.8695g sample of a mixture that contains an unknown amount of potassium chlorate (KClO3). The KClO3in the mixture decomposes and releases its oxygen. The mass of the remaining sample residue was 2.0427g. KClO3(s) →KCl (s) + 3 O (g) a.How many grams of oxygen were in the KClO3sample? b.How many moles of oxygen atoms is this? c.How many moles of KClO3were in the original sample? d.How many grams of KClO3were in the original sample? e.What is the % of KClO3in the original sample?
3. Consider the following balanced reaction: 2 Fe + 3 Cl₂ → 2 FeCl3 Given 60.0 g of Fe and excess Cl₂ (as much as we need), calculate: a. The theoretical yield of FeCl3, in grams. b. The theoretical amount of Cl₂ consumed, in grams.