### Transcription and Explanation for Educational Website---**11.16 Draw the condensed structural formula for each of the following alkanes:**a. **3-ethylpentane**b. **3-ethyl-2-methylheptane**c. **4-ethyl-2,2-dimethyloctane**d. **2-bromopropane**---### Explanation:For each of the compounds listed, you are required to draw the condensed structural formula. This involves representing the molecule in a way that shows the arrangement of atoms without explicitly depicting each bond. Alkanes are saturated hydrocarbons, meaning they consist only of carbon (C) and hydrogen (H) atoms connected by single bonds. Here’s a brief guide for each compound:- **3-Ethylpentane**: Pentane is a 5-carbon alkane chain. An ethyl group (C2H5) is attached to the third carbon of this chain.- **3-Ethyl-2-methylheptane**: Heptane indicates a 7-carbon chain. An ethyl group is attached to the third carbon, and a methyl group (CH3) is attached to the second carbon.- **4-Ethyl-2,2-dimethyloctane**: Octane is an 8-carbon chain. An ethyl group is on the fourth carbon, and two methyl groups are on the second carbon.- **2-Bromopropane**: Propane is a 3-carbon alkane. A bromine atom (Br) is attached to the second carbon.Each of these structural formulas highlights functional groups' positions and can be used to understand the alkane's overall shape and characteristics.

Since you asked multiple questions so as per Q&A guidelines of portal I solved first three parts…

Answered: 11.16 Draw the condensed structural…

11.16 Draw the condensed structural formula for each of the follow- ing alkanes: 3-ethylpentane a. c. 4-ethyl-2,2-dimethyloctane b. d. 2-bromopropane 3-ethyl-2-methylheptane 11.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: write the condensed structural formula of the following: a. 5,5-dimethyl-3-heptene b.…

Q: Draw the structures for the following compounds 1. 1-ethyl-4-methylcyclohexane 2.…

Q: write the condensed structure of the following: a. 5,5-dimethyl-3-heptene b. 3,3-diethyl-1-pentene…

Q: Draw the structüré óf éách óf thể following compounds: 2,3-dimethylhexane b.…

A: The structures of the given compounds has to be drawn.

Q: write the condensed formula of the following alkanes: 1. 2,2-dimethyl-4-ethyl-5-sec…

A: Condensed Structural formula of 1. 2,2-dimethyl-4-ethyl-5-sec butylcyclodecane 2. sec. hexyl 3.…

Q: HW: Classify each of the following condensed structural or skeletal formulas as an alkane, an…

A: (a) It is alkyne because alkynes exhibit atleast one triple (≡) bond in their structure.

Q: write the condensed structural formula of the following alkenes: a. 3,4-diethyl cyclohexene b.…

Q: 4. Write the cis and trans isomers for each of the following: a. 2-pentene b. 3-hexene c. 2-butene…

A: Cis and trans forms are geometrical isomers of each other.

Q: Analyze the given benzene ring structure and choose the correct IUPAC name of the structure.…

Q: IUPAC Name Condensed Structural Formula Zigzag line Structural Formula 1. Propyne 2.…

A: The condensed formula of a molecule is the formula where the symbols of atoms are shown with bond…

Q: Which of the ff statement/s is/are true about the properties of alkanes? a. Alkanes are generally…

A: PROPERTIES OF ALKANE : 1. Alkane contains all single bonds and are unreactive. 2. Alkane on…

Q: 11.20 Nonane has a density of 0.79 g/mL and boils at 151 °C. a. Draw the condensed structural and…

A: Hello. Since your question has multiple parts, we will solve first question for you. If you want…

Q: 4. Write the cis and trans isomers for each of the following: a. 2-pentene b. 3-hexene c. 2-butene…

Q: How many different carbon environments in 1. 3-methylpentane 2. propanoic acid 3. methypropane

A: 1.The structure of 3-methylpentane is given below. The carbon atom having same environment is…

Q: With the given IUPAC name, draw the structures for each of the following compounds: a.…

Q: Nomenclature Name the following alkanes using the IUPAC system of nomenclature. a. Write the…

A: Name the following alkane using the IUPAC system of nomenclature. ☆ IUPAC -> ▪︎If more than one…

Q: Draw a condensed formula for each of the following compounds: a. trans-2, 2-dimethyl-2-hexene b.…

Q: 24.35 Write the condensed structural fomula for each of the Tollowing compounds. a.…

A: The condensed structural formula for each of the given compounds has to be written.

Q: 11.32 Draw the condensed structural formula for b. trans-2-pentene cis-1,2-difluoroethene a. c.…

A: Condensed structural formula show the order of atoms like a structural formula but are written in a…

Q: Jsing the general formula for a 1.60), calculate the following: a. The number of hydrogen atoms E b.…

A: By using general formula of cyclo alkane to answer the following questions--

Q: Which of the following alkanes has the highest boiling point? Select one: O a. 2,2,3-trimethylbutane…

A: The temperature at which the vapor pressure of a liquid becomes equal to the atmospheric pressure is…

Q: Benzene undergoes substitution reactions rather than addition reactions because its ring structure…

Q: Draw the structural diagram for each of the following compounds: a. 3,4-diethyl 2,4-dimethyl…

A: We have to draw the structure of the compounds :- a. 3,4-diethyl 2,4-dimethyl hexane b.…

Q: Write the condensed structural formula for each of the following molecules: 1. ethylcyclopropane…

Q: Which of the following alkanes will have the lowest boiling point A. n- pentane B. isopentane C.…

A: A. Higher is the molecular weight of alkane, higher will be the intermolecular force (London…

Q: heptane b. Nonane c. Octane d. Dodecane e. Undecane

A: Different type of alkane are given and formula asked.

Q: 6. Draw three constitutional isomers for CH16. Give their IUPAC names.

A: Constitutional or structural isomers are compouds with same molecular formula and different…

Q: 1. 2-sec-butylheptane 2. 1,2,2- trimethylpentane 3. 1-methyl-2-isopropylpropane

Q: Draw a condensed and a skeletal structure for each of the following: a. 3,4-diethyl-2-methylheptane…

Q: of the following compounds is an alkyne? a. C₂H₁ b. C₂H6 6. Which C. CH d. C₁7H32 e. C₂H₁

A: The aim of this question is to explain Which of the following compounds is an alkyn.An alkyn is a…

Q: Draw a condensed and a skeletal structure for the each of following: a. 3,4-diethyl-2-methylheptane…

A: Since, In skelton structure, not write the C and H atom when valency is not complete then assume…

Q: B. DRAW THE CONDENSED STRUCTURAL FORMULA OF THE FF COMPOUNDS: 1. 4-Ethyl-hept-2-ene 2.…

A: In the condensed structural formula, we do not indicate the carbon-hydrogen and carbon-carbon single…

Q: 15. What is the IUPAC name of the compound shown below? CH₂-CH₂ CH₂-CH₂ A. 3-hexene B. cis-3-hexene…

A: The IUPAC name stands for International Union of Pure and Applied Chemistry. In an alkene, if same…

Q: 9. Draw the skeletal formula for each of the following: a. 3-methylheptane b. ethylcyclopentane c.…

A: a) The compound name is 3-methyl heptane. Hence the parent chain is of 7 carbon with no functional…

Q: 5. Draw the condensed structural formula for each of the following: a. trans-1-bromo-2-chloroethen…

A: a. The condensed structural formula for the given compound trans-1-bromo-2-chloroethene can be…

Q: What is the correct IUPAC name for the following compound CH3-CH(CH3)-CH(C2H5)-CH2-CH(CH3)-CH3?…

A: Basic Rule to write IUPAC Name (1) Select the longest chain (2) Numbering start from those side…

Q: 12.16 Draw the condensed structural formula for each of the following alkanes: a. 3-ethylpentane b.…

A: To write the condensed and the line angle formula of any organic compound, it is very important to…

Q: Draw the Structural a. 3-ethyl-2,2-dimethylpentane b. 5-ethyl-2,6-dimetyloctane

A: The structure of the compound is the arrangement of atoms in space. Various spectroscopic methods…

Q: Draw the structural formula of the following: a. 4-Isopropyl-3-ethynonane b.…

A: A systematic structure can be drawn for an organic compound from its IUPAC nomenclature. Write the…

Q: Which of the following IUPAC names is correct for the structural formula below? 5 O a.…

A: IUPAC nomenclature is used for naming the organic compounds as recommended by international union of…

Concept explainers

Alkanes and Cycloalkanes

Alkanes are saturated organic compounds which are made up of C and H atoms. Alkanes have the general formula of CnH2n+2. Alkane contains sp3 hybridized carbon atoms with four sigmas (σ) bonds & every hydrogen atom is connected with one of the carbon atoms. The size of the alkane could be determined by the number of carbon atoms located in it.

Question

### Transcription and Explanation for Educational Website

---

**11.16 Draw the condensed structural formula for each of the following alkanes:**

a. **3-ethylpentane**

b. **3-ethyl-2-methylheptane**

c. **4-ethyl-2,2-dimethyloctane**

d. **2-bromopropane**

---

### Explanation:

For each of the compounds listed, you are required to draw the condensed structural formula. This involves representing the molecule in a way that shows the arrangement of atoms without explicitly depicting each bond. Alkanes are saturated hydrocarbons, meaning they consist only of carbon (C) and hydrogen (H) atoms connected by single bonds. Here’s a brief guide for each compound:

- **3-Ethylpentane**: Pentane is a 5-carbon alkane chain. An ethyl group (C2H5) is attached to the third carbon of this chain.

- **3-Ethyl-2-methylheptane**: Heptane indicates a 7-carbon chain. An ethyl group is attached to the third carbon, and a methyl group (CH3) is attached to the second carbon.

- **4-Ethyl-2,2-dimethyloctane**: Octane is an 8-carbon chain. An ethyl group is on the fourth carbon, and two methyl groups are on the second carbon.

- **2-Bromopropane**: Propane is a 3-carbon alkane. A bromine atom (Br) is attached to the second carbon.

Each of these structural formulas highlights functional groups' positions and can be used to understand the alkane's overall shape and characteristics.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1 instructions

VIEW

Step 2 explanation

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Which of the following systematic names of aliphatic hydrocarbons is or are INCORRECT? Select one: O a. A and B O b. 3-ethyl-4,4-dimethylhexane O c. 2-ethylpropane O d. 2-methylbutane
Just answers to question 11.24
Give the structural formula of the ff: 1. n-hexane 2. n- butyl alcohol 3. sec- butyl alcohol 4. tert-butyl alcohol
Which of the following alkanes will have the lowest boiling point?
What is the structural formula, molecular formula, and emprical formula of the following a. 2, 3, 3, 4 - tetramethyl hexane b. 1, 2 - diethyl cyclopentane
C- Write False (F) or True (T) for the following sentences and correct the false sentences: 1. In Alkenes the Carbon atoms are connected to each other by a single bond. 2. An alkyne with 6 carbon atoms will have how many hydrogen atoms. 11. 3. Alkanes , the saturated hydrocarbons are those in which the carbon atoms bonded covalently to each other (fully occupied). Each carbon atom is tetrahedral surrounded by H-atoms. 4. Propane is the simplest member of alkane family and indeed the simplest of organic Compounds, as all other Compounds are derived by altering this compound. 5. Carbon expands its valence shell to accommodate more than eight electrons and thus forms double and triple bonds. are
Write structural formulas for the following organic compounds:
1. Write the name of the following alkanes using IUPAC names: A. B. C.
Write the structural formula (NOT LINE) for the following reactants: a. 2-methylpentane b. 3-flurooctane c. 2-bromoheptane
1. Which of the following would a carbon atom be unlikely to form: a. 1 double bond 2 single bonds b. 1 triple bond and a double bond c. 1 triple bond and a single bond d. 2 double bonds e. 4 single bonds 2. The simplest alkane is: a. Alkene b. Ethane c. Ethene d. Methane 3. Alkanes are used mostly for: a. Antiseptics b. Flavouring agents c. Fuel d. Perfume e. Weak acids 4. Which of the following is a saturated hydrocarbon? a) CH2CHCH2CH3 b) CH3CH2CH2CH3 c) CH3CH2CHCHCH3 d) CHCCH2CCH
13. Draw condensed structural diagrams and line structural diagrams for the following alkene names: a. 3-methylbut-1-ene b. 3-ethyl-4-methyl-3-propylhept-1-ene c. 2-ethyl-3,4-dimethylhept-1-ene d. 3-methylpent-1-ene e. 3-ethyl-4,5-dimethylhex-1-ene
Write the condensed structural formula of the following: 1. 3- Hexene-1-Yne 2. Cycloheptene 3. 2- methyl-2-pentene