1. Give an acceptable IUPAC name for each of the following CH3(CH2)5CO2H and HO2C(CH2)6CO2H. 2. What is the reason for the high boiling point of acetic acid compared to ethanol? Explain using your own words. 3. Which is the stronger acid in each of the following pairs? or ОН ОН 4. Write an ionic equation for the reaction of Acetic acid with Potassium tert- butoxide. Provide the definition of Micelles. 5. Predict the principal organic product for the following reaction. 1. KMNO4, OH- 2. HзО* O2N CI

1. Give an acceptable IUPAC name for each of the following CH3(CH2)5CO2H and HO2C(CH2)6CO2H. 2. What is the reason for the high boiling point of acetic acid compared to ethanol? Explain using your own words. 3. Which is the stronger acid in each of the following pairs? or ОН ОН 4. Write an ionic equation for the reaction of Acetic acid with Potassium tert- butoxide. Provide the definition of Micelles. 5. Predict the principal organic product for the following reaction. 1. KMNO4, OH- 2. HзО* O2N CI

Chemistry for Today: General, Organic, and Biochemistry

9th Edition

ISBN:9781305960060

Author:Spencer L. Seager, Michael R. Slabaugh, Maren S. Hansen

Publisher:Spencer L. Seager, Michael R. Slabaugh, Maren S. Hansen

Chapter14: Aldehydes And Ketones

Section: Chapter Questions

Problem 14.51E: Identify the most important aldehyde and ketone from Section 14.4 on the basis of amount used, and...

See similar textbooks

Similar questions

1).For each of the following, draw one structural formula that meets all stated requirements, then name each structure you drew according to either IUPAC or common nomenclature.
1. Write in the correct reagents to accomplish these reactions. a) 2-methyl-2-pentanol b) CH3CH2CH₂OH → 2-chloro-2-methylpentane CH3CH₂CH
Why is the boiling point of propane-1,3-diol (HOCH2CH2CH2OH) higher than the boiling point of propane-1,2-diol [HOCH2CH(OH)CH3] (215 °C vs. 187 °C)? Why do both diols have a higher boiling point than butan-1-ol (CH3CH2CH2CH2OH, 118 °C)?
II. Write the chemical equation showing reactants, products and catalysts needed (if any) for the following reactions. Write the IUPAC name for the organic compound below its structure. 1. Reaction of p-methylbenzaldehyde with oxygen. 2. Reaction of 4-ethylheptanal with CrO3 and H3O* in the presence of acetone 3. Reaction of 2,4-pentanedione with 2moles of hydrogen 4. Reaction of 4-chlorobutanal with Imole of hydrogen 5. Reaction of two 2-pentanethiol HgC CH3 6. Oxidation of H3C HO, 2,4- dime thyl bwtanol 7. Oxidation of H. 9. Hydrogenation of SH 10. Reaction with chloromethane of
Help
I. Complete the table. Classification of Carboxylic Acids and its derivatives No. Common Name Structure IUPAC Name 1. CH3CH2CH2COONA COOH(CH2)SCOOH 3. CH3CH2CH2CH2CH2COOH 4. C6HSCOOCOC6H5 5. CICOCH2CH2CH2CH2OH 6. CH3(CH2)7CONH2 7. CH3(CH2)3CH2COOCH2(CH2).CH3 CH3CH2OCOCH2CH2CH2CH2CH2CH2 8. CH3 9. CH3CH2CH2CH2CH2CH2CH2CH2COCI 10. H2NCOCH2CH2CH2CH3 2.
Based on the image attached, which of the following is the correct systematic name for the compound? A. 3-benzyl-6-bromo-3-ethyl-2-methyldecan-7,8-diol B. 5-bromo-8-cyclohexyl-8-ethyl-9-methyldecan-3,4-diol C. 3-benzyl-6-bromo-3-isopropyldecan-7,8-diol D. 5-bromo-8-cyclohexyl-8-isopropyldecan-3,4-diol
Choose the best explanation for why these compounds are all less than fifteen carbons. A) Aldehydes with longer alkyl chains become increasingly nonpolar and the LDF are stronger than hydrogen bonding with ethanol. B) Ethanol molecules will hydrogen bond with the oxygen of the aldehydes. However, longer alkyl chains interrupt the ability of the aldehyde to hydrogen bond with ethanol which decreases the solubility. C) Ethanol molecules will form strong LDF interactions between the alkyl chains of the aldehydes and the alkyl groups of ethanol. The strong attractions cause the aldehydes to precipitate out of solution. D) When aldehydes chain length increases, the aldehydes have stronger intermolecular force with the small ethanol solvent molecules than the ethanol-ethanol intermolecular force.
Write the chemical equation showing reactants, products and catalysts needed (if any) for thefollowing reactions. Write the IUPAC name of the product right beside the structure. a) Reaction of two phenol b) Reaction of 2-bromophenol with sodium hydroxide c) Reaction of potassium phenoxide with 2-chloropentane d) Reaction of isopropyl propyl ether with HBr e) Reaction of 3-methylpentan-3-ol with sulfuric acid f) Dehydration of 1,5-hepta-diolg) Oxidation of 1-decanolh) Hydration od hepta-2,3-diene
explain why is OH group in phenols more strongly held as compared to OH group in alcohols.
Identify the most important aldehyde and ketone from Section 14.4 on the basis of amount used, and list at least one characteristic for each that contributes to its usefulness.
Give IUPAC names for the following substances: