I don't understand this part 1. Balance the following equations.CaCl(aq) +Na,SO, (aq) →CASO(s) +NaCl(aq)a.b.PbO(s) +NH3 (g) →Pb(s) +N2(g) +H,O(g)c.C,H,OH(!) +CO.(g) +_H,O(g)– (3*02. A compound composed of carbon and hydrogen with the formula CxHy was burned. Thebalanced chemical equation is shown below.2 CxHy+ 1302 (g) –→8 CO2(g) + 10 H,0(g)Using only the information found within the chemical equation, determine what number x equalsto and what number y equals and write the correct formula for the compound.

Here, we shall attempt only the first question which allows us to balance the given chemical…

Answered: 1. Balance the following equations.…

1. Balance the following equations. CaCl(aq) + Na,SO, (aq) - CaSO(s) + _NaCl(aq) a. b. PbO(s) + NH; (g) - Pb(s) + N2(g) + _H,O(g) CH,OH(1) +, 0.(g)→ CO.(g) + H,0(g) с.

Introductory Chemistry: A Foundation

9th Edition

ISBN:9781337399425

Author:Steven S. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Donald J. DeCoste

Chapter7: Reactions In Aqueous Solutions

Section: Chapter Questions

Problem 3CR

See similar textbooks

Similar questions

Write the balanced chemical equation for the complete combustion of adipic acid, an organic acid containing 49.31% C, 6.90% H, and the remainder O, by mass.
4.69 The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH. The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
Ethanol, C2H5OH, is a gasoline additive that can be produced by fermentation of glucose. C6H12O62C2H5OH+2CO2 (a) Calculate the mass (g) of ethanol produced by the fermentation of 1.000 lb glucose. (b) Gasohol is a mixture of 10.00 mL ethanol per 90.00 mL gasoline. Calculate the mass (in g) of glucose required to produce the ethanol in 1.00 gal gasohol. Density of ethanol = 0.785 g/mL. (c) By 2022, the U. S. Energy Independence and Security Act calls for annual production of 3.6 1010 gal of ethanol, no more than 40% of it produced by fermentation of corn. Fermentation of 1 ton (2.2 103 lb) of corn yields approximately 106 gal of ethanol. The average corn yield in the United States is about 2.1 105 lb per 1.0 105 m2. Calculate the acreage (in m2) required to raise corn solely for ethanol production in 2022 in the United States.
You take 1.00 g of an aspirin tablet (a compound consisting solely of carbon, hydrogen, and oxygen), burn it in air, and collect 2.20 g CO2 and 0.400 g H2O. You know that the molar mass of aspirin is between 170 and 190 g/mol. Reacting 1 mole of salicylic acid with I mole of acetic anhydride (C4H6O3) gives you 1 mole of aspirin and 1 mole of acetic acid (C2H4O2). Use this information to determine the molecular formula of salicylic acid.
The space shuttle environmental control system handles excess CO2 (which the astronauts breathe out; it is 4.0% by mass of exhaled air) by reacting it with lithium hydroxide, LiOH, pellets to form lithium carbonate, Li2CO3, and water. If there are seven astronauts on board the shuttle, and each exhales 20. L of air pee minute, how long could clean air be generated if there were 25,000 g of LiOH pellets available for each shuttle mission? Assume the density of air is 0.0010 g/mL.
(a) Butane gas, C4H10, can burn completely in air [use O2(g) as the other reactant] to give carbon dioxide gas and water vapor. Write a balanced equation for this combustion reaction. (b) Write a balanced chemical equation for the complete combustion of C3H7BO3, a gasoline additive. The products of combustion are CO2(g), H2O(g), and B2O3(s).
The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. D Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
A power plant is driven by the combustion of a complex fossil fuel having the formula C11H7S. Assume the air supply is composed of only N2 and O2 with a molar ratio of 3.76:1.00, and the N2 remains unreacted. In addition to the water produced, the fuels C is completely combusted to CO2 and its sulfur content is converted to SO2. In order to evaluate gases emitted at the exhaust stacks for environmental regulation purposes, the nitrogen supplied with the air must also be included in the balanced reactions. a Including the N2 supplied m the air, write a balanced combustion equation for the complex fuel assuming 100% stoichiometric combustion (i.e., when there is no excess oxygen in the products and the only C-containing product is CO2). Except in the case of N2, use only integer coefficients. b Including N2 supplied in the air, write a balanced combustion equation for the complex fuel assuming 120% stoichiometric combustion (i.e., when excess oxygen is present in the products and the only C-containing product is CO2). Except in the case of use only integer coefficients c Calculate the minimum mass (in kg) of air required to completely combust 1700 kg of C11H7S. d Calculate the air/fuel mass ratio, assuming 100% stoichiometric combustion. e Calculate the air/fuel mass ratio, assuming 120% stoichiometric combustion.
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
3.122 What type of reasoning were we using when we developed the equation for dilution, MiVi=MfVf ?
3.75 The following pictures show a molecular-scale view of a chemical reaction between the compounds AB2 and B2. (A atoms are shown in blue and B atoms in white). The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reac- tion has gone to completion. Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
The carbon dioxide exhaled in the breath of astronauts is often removed from the spacecraft by reaction with lithium hydroxide 2LiOH(s)+CO2(g)Li2CO3(s)+H2O(l) Estimate the grams of lithium hydroxide required per astronaut per day. Assume that each astronaut requires 2.50 103 kcal of energy per day. Further assume that this energy can be equated to the heat of combustion of a quantity of glucose, C6H12O6, to CO2(g) and H2O(l). From the amount of glucose required to give 2.50 103 kcal of heat, calculate the amount of CO2 produced and hence the amount of LiOH required. The H for glucose(s) is 1273 kJ/mol.