✓ 1 ✓ 2 = 3 ✓ 4 ✓ 5 = 6 = 7 Provide the IUPAC name for the following compound: CH3CH2CH2CH(CH2CH3)CH(CH2CH3)CH2CH2CH2CH3 X 4,5-diethyloctane Check MacBook Pro

Q: Instructions translate to English if you don't understand Spanish. Drawings that you have to guide…

A:

Q: Whats the name of product and explain

A: Type of alkene having double bond at the extreme of the hydrocarbon chain is termed as terminal…

Q: ▼ ▼ Part A CH3-0-CH₂-CH3 Spell out the IUPAC name of the compound. Submit Request Answer Part B…

A: IUPAC nomenclature rule for ether: 1) first you need to identify the alkyl groups on both the side…

Q: What is the IUPAC name of the following compound? н CHа н н CHа н T

A: For giving IUPAC name to the given compound,First identify the parent carbon chain and number it in…

Q: What is the condensed structural formula for 3,3-diethyl-2-methylpentane?

A: 3,3-diethyl-2-methylpentane. Condensed Structural Formula:- It is a method to write a compound…

Q: OH CH,NH2 R s CN v a structural formula of the R configuration of the compound shown below. HO w a…

A:

Q: help please answer in text form with proper working and explanation for each and every part and…

A: The first step in naming an organic compound is to identify the longest continuous chain of carbon…

Q: Question 20 For the compound below please choose the correct set of chair and flipped chair…

A:

Q: Write the complete common (not IUPAC) name of each molecule below. Note: if a molecule is one of a…

A: Given that, the structure of the amino acids are:

Q: 9 Provide the IUPAC name of the following compound BrC=CCHCI (CH₂) CH 3

A:

Q: Give the IUPAC name for each compound. Part 1 of 2 Name: Part 2 of 2 Name: X X Ś S

A: Nomenclature rules for the cycloalkane: 1) Identify the longest continuous carbon ring.2) Identify…

Q: Name of parent chain Position number/s and name/s of substituents IUPAC Name Сompound CHyCCH, CH3…

A: Function groups and the maximum number of carbons should be in the parent.

Q: 5) Which of the following statements is a correct description of the most stable conformation of…

A:

Q: Type only one correct ACRONYM or only one short abbreviation for each chemical structure used below:…

A: “Since you have posted a question with multiple sub parts, we will provide the solution only to the…

Q: Arrange these compounds in order of increasing boiling point. Use the boiling point values of 0°C,…

A: Boiling point - The temperature at which the vapour pressure of a liquid is equal to the pressure of…

Q: Provide the IUPAC name for the following compound: CHCH2CH2CH(CH2CH3CH(CH2CH3CH2CH2CH2CH3 X…

A: Lets draw the structure of given component,  IUPAC name of component is, 4,5-diethylnonane…

Q: What is the IUPAC name of the molecule shown? CH, CH3 O 1,2-dimethylcyclobutane О сyclohexanе O…

A:

Q: What is the correct IUPAC name for the following compound?   Group of answer choices…

A:

Q: What is the IUPAC name for the compound shown? OH IUPAC name:

A:

Q: Your answer C6HSCH2OCO(CH2)¬CH3 Your answer

A:

Q: Part B H C(CH₂)3 H CH₂CH3 Spell out the full name of the compound. 1-tert-butyl-3-ethylcyclohexane…

A: The rules for IUPAC nomenclature are as follows.The longest chain is the parent chain.The…

Q: 1. PBR3 IR (cm-1): 3480 (broad), 2800-3000, 1708 (strong) HO MS (m/z): 86 (molecular ion) 2. но 3.…

A: There is error in your 5th step.  You can check out 2 step to get your mistake.

Q: CNHCH₂CI CNHCH₂CH₂CH₂CH3 CH2CH2CH2CH3

A:

Q: What is the name of the following compound? (CH3)2CHCH2CH(CH2CH3)CH2C(CH3)3 O…

A:

Q: Question 1 The correct IUPAC name for the structure below is 2,5,6-trimethyldecane CH3…

A:

Q: c) CH, CH₂ CH__CH__CH_с_CH, он сн, CH, e) C-CH2-CH2-CH, CH, CH₂ CH,`CH-CH, CH–CH,-CH-C—CH, CH3 ҫн,…

A: When there are multiples of a certain kind, use numerical prefixes like di-, tri-, tetra-, etc. to…

Q: Give the IUPAC name of the given compound Blank 1

A: IUPAC nomenclature of ethers follows different guidelines. According to IUPAC naming, substituent…

Q: None

A: To determine the IUPAC name of the compound shown, follow these steps:Identify the Ring Structure…

Q: E2 S What is the correct IUPAC name for the following substance? CI (S)-1-chlorospiro[2.5]octane…

A: The given compound is a spirocyclic compound as two rings are fused together through one common…

Q: What is the correct IUPAC name for the compound shown here?

A: IUPAC nomenclature refers to the standardized system of naming chemical compounds established by the…

Q: Provide the IUPAC name for the following compound: Br X NH₂ 5

A: The IUPAC nomenclature rules for aromatic compounds isPlace the substituent name before the compound…

Q: What is the IUPAC name of the following compound? 1S 1は. CD

A:

Q: Provide the correct IUPAC name for the compound shown here. 11 3- 2- 6- 4- 7- 5- iso tert- sec- di…

A: For the systematic name or IUPAC name of organic compounds there are some rules as follows; Choose…

Q: What is an acceptable name (IUPAC or common) for the molecule shown below? 20-CH₂CH(CH3)2…

A: Given that, the structure of the molecule is:

Q: (CH,(CH,),CH;) will react with gaseous oxygen (0,) to produce gaseous carbon dioxide (CO,) and…

A:

Q: Write down the IUPAC name of the structure shown. H₂C- Write down the IUPAC name of the structure…

A: The IUPAC names of the compounds are given as below-

Q: Write the complete common (not IUPAC) name of each molecule below. Note: if a molecule is one of a…

A: Step 1:These compounds are amino acid. The alpha carbon is connected to COO-, amino group, a…

Q: What is the IUPAC name of the following compound? (CH3)3CCH2CH(CH2CH3)(CH2)2CH3 O…

A:

Q: 5 eBook Print eferences What is the IUPAC name of the compound below? CH,CH,CH(CH3) CH3CH₂CH₂CHCHCH3…

A: IUPAC nomenclature of organic chemistry is a method of naming organic chemical compounds as…

Q: Can i get help step by step please

A: Steps to determine IUPAC names of alkanes- 1) select the longest continuous chain. 2) Number the…

Q: CH3 CH3 CH3 CH3CH2CH-CH-CH-CH2CH-CH3 CH2CH3

A: Rule of IUPAC- 1) Longest chain as parent chain. 2) Numbering start from those side where more prior…

Q: Arrange the compounds by increasing boiling point. Lowest boiling point CH₂CH₂CH₂CH₂CH₂ CH,CH,CO,CH,…

A: Boiling point can be defined as the temperature  at which a liquid starts converting into vapour…

Q: What is the IUPAC name of the given compound? CH,CH, CH,CH,CH,CHCH,C=CCHCH,CH, CH,CH, 2,4- diethyl -…

A:

Q: Write the IUPAC name for the compound below. Be sure to use correct punctuation. CHy-CH-CHy-CH,…

A: i) The longest carbon chain in the given compound contains nine carbon atoms. Therefore, the root…

Q: Which one of the following compounds has the highest melting point? O CH₂OC(CH₂)7CH-CH(CH₂)7CH3…

A: Selecting the compound with the most elevated melting point involves considering the length of…

Q: Question 21 For the compound below please choose the correct set of chair and flipped chair…

A: The basic principle is; the bulky group should always come at equatorial position.The higher the…