Given the reaction mechanism:k1(i) N205 NO2 + NO3(ii) NO3k202 + NO(iii) NO+ N205k33NO2Solve ford[NO3].dta. -ki[N2O5]-k1[NO2][NO3]+k2[NO3]b. -k1[N2O5]+k1[NO2][NO3]-k2[NO3]C.k:[N2O5]+k1[NO2][NO3]+k2[NO3]d. kı[N2O5]-k1[NO2][NO3]-k2[NO3]

Answered: Image /qna-images/answer/0e580e80-f4fb-434f-87c9-3d1d4c6dd5cc.jpg

Given the reaction mechanism: k1 (i) N2O5 NO2 + NO3 (ii) NO3 k2 02 + NO (iii) NO+ N½05 k3 3NO2 Solve for d[NO3]. dt a. -kı[N2O5]-k1[NO2][NO3]+k2[NO3] b. -kı[N2O5]+k1[NO2][NO3]-k2[NO3] C. k:[N2O5]+k1[NO2][NO3]+k2[NO3] d. kı[N2O5]-k1[NO2][NO3]-k2[NO3]

Given the reaction mechanism: k1 (i) N2O5 NO2 + NO3 (ii) NO3 k2 02 + NO (iii) NO+ N½05 k3 3NO2 Solve for d[NO3]. dt a. -kı[N2O5]-k1[NO2][NO3]+k2[NO3] b. -kı[N2O5]+k1[NO2][NO3]-k2[NO3] C. k:[N2O5]+k1[NO2][NO3]+k2[NO3] d. kı[N2O5]-k1[NO2][NO3]-k2[NO3]

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: The rate constant for the second-order reaction 2NOB)→ 2NO(g) + Br2(g) is 0.80 M¹s¹ at 10 °C. A.…

Q: N202(8) H2Olg) + N2O(g) N20(g) ka k3 N20(g) H20(g) + N2(g) = k[H2][NO]? = k[H2][N2O2] = K[N2O2]?…

A: Rate of the reaction is defined as change in concentration with respect to time.

Q: A chemistry graduate student is studying the rate of this reaction: 2N₂O5 (g) → 2N₂O4 (g) + O₂ (g)…

A: Answer: This question will be solved using trial and error method where we will check that in which…

Q: 16. At higher temperatures, the same reaction: 2 NO2(g) 2 NO(g) + O₂(g) follows second order…

A: #16: Arrhenius equation in logarithmic forms is: ln(k) = -EaR*1T + ln(A) If we compare the above…

Q: at is the concentration eaction is 2 seconds? c)1.01 x 102 M d) 6.22 x 103 M Q5) The following…

A: Given: Rate constant at 550 oC = 1.8 M-1s-1 And rate constant at 25 oC = 2.8 M-1s-1

Q: a. Determine the activation energy for this reaction. b. Determine the value of the frequency…

A: Rate of a reaction depends on the temperature. According to the Arrhenius equation, k=Ae-EaRT k is…

Q: A products Time, s [A ], M 1.00 25 0.80 75 0.57 150 0.40 Fit this data into the integrated rate laws…

A: According to question,Given data, [A] (in M) Time (In sec) 1.00 0 0.80 25 0.57 75 .40…

Q: For the reaction: 4PH3(g) P4(9) + 6H2(g) d[P4]/dt = 3.3x10 M/s at a particular temperature and set…

A: The rate of the reaction is the ratio between the difference in concentration of reactant with…

Q: The kinetics of a gas phase reaction of the form A Products results in a rate constant of 0.00781…

Q: Consider the reaction mechanism shown below Step 1. H₂O₂ t H₂O + 10 slow Step 2. 10+ H₂02 H₂O + 0₂ +…

A: Activation energy is the amount of energy required by a species to form product.

Q: Consider the hypothetical reaction: A3+ B22AB + A The rate law for the overall reaction is rate =…

A: Answer: Slowest step of the reaction is the rate determining step and according to law of mass…

Q: 2. Which equation is used to calculate the half-life of the first-order equation below? A ® 2B…

A: Given reaction, A -> 2B rate = k[A]

Q: Q31. Find the percentage of unreacted reactant A in a first-order reaction under the following…

A: Given(1).(2).Determine the percentage of uncreacted reactant A in first order reaction.

Q: How long will it take for the concentration of A to decrease from 1.25 M to 0.205 for the second…

A: FOR SECOND ORDER REACTION kt = 1/[A] -1/[A]o where k = rate constant of reaction t= time elapsed…

Q: What is the half-life for a particular reaction if the rate law is rate = (1301 M 1*min 1)[A]² and…

A: Given-> Initial concentration of A = 0.250 M Rate= (1301M-1min-1)[A]2

Q: The reaction A → C was performed and the concentration vs. time data below collected. 4 time, s 0 1…

A: The integrated rate law for the Zero order reaction is [A]=-kt+[A]o. If a plot of [A] vs time (t)…

Q: Q1) consider the following reaction: 2Xy X2 + Y2 The following data were obtained for this reaction…

A: First we have to find order of reaction. We use hit trial method. We find Rate constant, if two Rate…

Q: How would you find the concentration of the M third body in a third order rate reaction? The end…

A: Rate of reaction represents the change of concentration of a reactant or a product with respect to…

Q: 1. The data below show the concentration of N₂O5 versus time for the following reaction: N₂O5(9) →…

Q: y mayret vecompomacove YO 3Ize/orientation lenerau 2. A student studied the clock reaction described…

A: For the above qustion calculation is given under.

Q: 11. Which of the following represents the integrated rate law for a first-order reaction? A. In =…

A: Thank You,

Q: Estimate the rate constant for the reaction: H₂ + C2H4 -> C2H6 at 628 K. Given that the activation…

A: To estimate the rate constant for the reaction H2+C2H4→C2H6 at 628 K, we can use the Arrhenius…

Q: The graph on the right below shows a plot of In(k) vs 1/T for a certain first-order reaction. i.…

Q: Consider the mechanism. step 1: step 2: overall: B₂ O A Which species is an intermediate? BC A + BC…

Q: 7. A mechanism for the destruction of ozone in the stratosphere is depicted below, where M…

A: The question asks us to derive an expression for the rate of change of the concentration of O3…

Q: The elementary reaction 2NO2 (g) --> 2NO (g) + O2 (g) is second order in NO2 and the rate…

A: Since we know that the relationship between the concentration of reactant i.e [A] and time for a…

Q: a. Determine if this mechanism is valid. p. Identify any intermediates. c. Select the answer below:…

A: The rate of a reaction is determined as the change in concentration of the reactant or the product…

Q: A certain reaction is first order in N, and second order in H. Use this information to complete the…

A: The rate of the given reaction is first order with respect to N2 and second order with respect to…

Q: Temperature (K) 195 230 260 298 369 etermine the value of activa ints: Arhenius Equation Ea + R…

Q: 3 2 1 0 -1 -2 0.00086 0.00088 0.0009 Arrhenius Plot 0.00092 0.00094 0.00096 0.00098 0.001 0.00102 B.…

A: Below are the required data:

Q: The activation energy for a particular reaction is 102 kJ/mol. If the rate constant is 1.35 x 10 s1…

A: The rate constant will be calculated by using integrated arrhenius equation. Rate constant of…

Q: Examine the reaction mechanism found below: Step 1: HCI+S2 +Br2 HS2BrCl + Br Step 2: HCl + H…

A: The question is based on the concept of chemistry kinetics. we need to identify catalyst ,…

Q: Consider the reaction and its rate law. 3 A +3B → products What is the order with respect to A? 0…

Q: Consider the reaction below: k NO + NO ki N202 (fast) N2O2 + C2 2NOCI (slow) (i) By assuming steady…

A: We have the following overall reaction: 2NO+Cl2→2NOCl This reaction occurs via the following 2 steps…

Q: What is the concentration of A after 50.5 minutes for the second order reaction A Products when the…

Q: Tin Consider the reaction below to answer the following questions The kinetically controlled product…

Q: Reaction Mechanisms 1. The kinetics of the reaction: 2X + Y→ Z was studied, and the results are:…

A: Note: As per guidelines, in case of multiple questions, only one is to be answered; hence, post the…

Q: The following initial rate data are for the reaction of UO₂+ with hydrogen ion in aqueous solution:…

Q: Experiment Initial [A]/M Initial [B]/M Initial rate/ M s-1 1 0.020 0.010 0.0010 2 0.020 0.020 0.0040…

Q: app. ledu.co Submit Question 16 of 25 A reaction was shown to follow second-order kinetics. How much…

A: Chemical kinetics is defined as branch of chemistry which is related to rates of chemical reactions.

Q: Analyze the following reaction mechanism: H2O + O → CIÓ + CF2CI CI + 202 4. Cl + CF2CI –→ CF2CI2 1.…

Q: O [A] vs Time O In[A] vs Time O 1/[A] vs Time Least Squares Plot Time, s The reaction A - C was…

A: For a first order reaction we plot a graph between ln[A] versus time where [A] is concentration of…

Q: 1. Draw the following potentialenergy diagrams and fill in the missing values. Potential energy of…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: Find the mechanism for this reaction..

A: I have tried my best to make you understand properly but still if any further queries regarding the…

Q: Determine the activation energy for the Reaction Energy Diagram below: PE (kJ) 100 80 60 40 20 A+B…

Q: important values if needed for this question. The activation energy for the gas phase decomposition…

A: The given reaction is the decomposition of vinyl ethyl ether. Activation energy = 183 kJRate…

Q: Butadiene reacts to form a dimer according to the equation 2C4H6(g)-->C8H12(g) The following data…

A: The integrated rate law for the Zero order reaction is [A]=-kt+[A]o The integrated rate law for the…

Question

Given the reaction mechanism:
k1
(i) N205 NO2 + NO3
(ii) NO3
k2
02 + NO
(iii) NO+ N205
k3
3NO2
Solve for
d[NO3].
dt
a. -ki[N2O5]-k1[NO2][NO3]+k2[NO3]
b. -k1[N2O5]+k1[NO2][NO3]-k2[NO3]
C.
k:[N2O5]+k1[NO2][NO3]+k2[NO3]
d. kı[N2O5]-k1[NO2][NO3]-k2[NO3]

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Consider the reaction mechanism shown belo Step 1. H₂O₂ + H₂O + 10- Step 2. 10* + H₂Qz H₂O + O₂ + I slow fast W 70 60 40 30 10 Progress of the Reaction The reaction coordinate diagram for this mechanism is show below. What is the activation energy for Step 2 of the mechanism? 50 kJ/mol/none of the answers are correct/20 kJ/ml/30 kJ/mol/ -20 kJ/mol Potential Energy (kJ/mol)
For the following basic steps, A2 = A + A (fast; k1, k-1) A + B ---> Products (k2) a. What is the molecularity of the direct step 2 process? b. Using the pre-equilibrium approximation, derive the expression for the predicted rate law for product formation. vs. What is the overall order of the reaction? d. Since k1 is equal to 3.8 x 109 s-1, k-1 is equal to 9.8 x 10^8M-1s-1 and k2 is equal to 2.3 x 10^6M-1s-1, and that the activation energy for the overall process was determined to be 135.2 kJ mol-1 when measured at 300 K, calculate the overall k value for the reaction at T = 550 K.
6:29 PM Sun Feb 5 Tap here or pull up for additional resources A reaction was shown to follow second- order kinetics. How much time is required for [A] to change from 0.500 M to 0.240 M? (k = 0.456 M-¹s¯¹) @ 2 # 3 $ 4 % 675 *** Question 32 of 50 6 & 7 8
Given the reaction below and its reaction mechanism: 2A + 20 -> F + 2E Step 1: A + A B kj/k1 (very very fast) Step 2: B+ C ->D+E_ k2 (fast) Step 3: D + C-> E+ F k3 (slow) Using steady state approximation, derive the rate law from the reaction mechanism above. (Upload a picture or file of your solution) A - В I = E EE Maximum file size: 250MB, maximum number of files: 1
(50,00 Puanlar) 1- Decomposition reaction of ozone (03) in water follows second-order kinetics with a rate constant of 70 M-1sec-1. Assuming that the initial concentration of ozone in water is 1x10-4 M. how many seconds are required for the concentration of ozone to reach 2.5x10-5 M? 015022 92.6 b) 116.9 c) 174.6 265.3 428.6 Boş bırak
For the overall reaction: 2 NO (g) + 2 H2 (g) → N2 (g) + 2 H20 (g) The following 3-step reaction mechanism was proposed. 2 NO N,O2 (fast equilibrium) N,O, + H, N,0 + H;O (slow) N,0 + H, N3 + H,O (fast) not used in rate а. What is the rate limiting step. b. Are there any intermediates or catalysts if so which are they? What is the rate law for the reaction? It must use species present in the overall reaction only (aka no intermediates). * с.
Consider the mechanism. step 1: step 2: overall: Which species is an intermediate? O AB A B3 B2 A + B₂ → AB + B₂ 2 2B₂ B AB + B B3 + A B3 + B Which species is a catalyst? B3 AB B₁ 2 B A
What are the units for the rate constant (k) for an overall first-order reaction? O M. S-¹ O S-1 O M-¹.5-1 Not enough information
C blackboard.sc.edu Content Blackboard Lea... > Recitation W3... J Late Model Ca... rate = k[N₂01² Question 3 Worksheet 13.6 #2 X Consider the two-step mechanism below that has been proposed for the reaction of nitrous oxide to form nitrogen and oxygen gas to answer the following questi Step 1: N₂0 (g) → N2 (9) + O (g) (slow) (fast) Step 2: N₂O(g) + O (g) → N2 (g) + O2 (9) Net: 2 N₂O (g) → 2 N2 (9) + O2 (9) Part B: Based on the proposed rate law for the net overall reaction, what is the overall order of the reaction? Selected Answer: 1/2 order Worksheet 13.6 #2 Consider the two-step mechanism below that has been proposed for the reaction of nitrous oxide to form nitrogen and oxygen gas to answer the following questi Step 1: N₂O (g) → N₂ (g) + O (9) (slow) (fast) Step 2: N₂O(g) + O (g) → N₂ (9) + 02 (9) Net: 2 N₂0 (g) → 2 N2 (9) + 02 (9) Part C: What intermediates/catalysts are present in this mechanism? Selected Answer: N₂O is a catalyst; there are no intermediates Wednesday, April 6,…
What is the standard free energy of the transition state for a first order reaction proceeding at 45°C at a rate of 1500 s-1. Gas constant = 8.31 J. mol-¹. K-¹; Bond vibrational frequency = 6.2 × 10¹² s-¹ S
3-4918-975c-89f6e8a7730a/5/kpbvh2/tools/assessment/items/b88e2b23-7e79-4400-8091-76ff872c8c47/assignments/7378890.. = 32.9% # Ⓒ Macmillan Learning Using the data in the table, calculate the rate constant of this reaction. A+B C + D k= $ 4 % 5 F < 6 MacBook Pro A & 7 * CO 8 Trial [A] (M) 1 2 3 Units Resources 0.390 0.390 0.507 ( 19 [B] (M) 0.350 0.910 0.350 -0 ) Rate (M/s) 0.0185 0.125 0.0241 Hint {
5.00 mL 4.50 M acetone + 10.0 mL 1.15 M HCl + 10.0 mL 0.00200 M I2 + 25.0 mL H2O A student found that it took 146 seconds for the color of the I to disappear. a. What was the rate of the reaction? Hint: First find the initial concentration of Iz in the reaction mixture, [I2]o. Then use the equation Rate At t M/s b. Write the rate equation. (Abbreviate acetone to ace, H* ion to H", and iodine to I2. Represent the order of reaction with respect to acetone as m, the order of reaction with respect to iodine as n, and the order of reaction with respect to H* as p). c. Select all the unknown variables in the equation in part (b). Rate O[Ace] (Previous Next